Dichlofluanid (Ref: BAY 47531) |
(Also known as: dichlofluanide; KUE 13032c) |
Dichlofluanid is a fungicide. It has a low aqueous solubility and is volatile and, based on its chemical properties, it is unlikely to leach to groundwater. It is not persistent in most soil or aquatic systems. Dichlofluanid has a low mammalian toxicity but, with the exception of birds, is moderate to highly toxic for most biodiversity including aquatic life, bees and worms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 |
Human health Low alert
 Warning: Significant data are missing |
|
Fungicide used control a wide range of diseases on fruit and ornamentals |
|
Rust; Brown spot; Botrytis cinerea; Alternaria; Storage diseases; Scab; Black spot |
|
Fruit including apples, pears, grapes, strawberries, loganberries, cuurants; Ornamentals |
|
- |
|
Current |
|
1965 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₁₁Cl₂FN₂O₂S₂ |
|
CN(C)S(=O)(=O)N(C1=CC=CC=C1)SC(F)(Cl)Cl |
|
- |
|
WURGXGVFSMYFCG-UHFFFAOYSA-N |
|
InChI=1S/C9H11Cl2FN2O2S2/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
|
Yes |
|
Fungicide, Acaricide, Insecticide |
|
Biocide |
|
Sulfamide fungicide; Phenylsulfamide fungicide; Sulfamide insecticide; Phenylsulfamide insecticide; Sulfamide acaricide; Phenylsulfamide acaricide |
|
- |
|
- |
|
Synthetic |
|
Foliar with protective action. Multi-site activity. Potent inhibitor of fungal spore germination. |
|
1085-98-9 |
|
214-118-7 |
|
74 |
|
128844 |
|
14145 |
|
616-006-00-7 |
|
333.23 |
|
N-{[dichloro(fluoro)methyl]sulfanyl}-N',N'-dimethyl-N-phenylsulfuric diamide |
|
N-dichlorofluoromethylthio-N',N'-dimethyl-N-phenylsulfamide |
|
1,1-dichloro-N-((dimethylamino)sulfonyl)-1-fluoro-N-phenylmethanesulfenamide |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
M06 |
|
- |
|
Colourless powder |
|
|
|
|
|
|
|
Usually formulated as wettable powders or as dustable powders |
|
|
|
|
|
1.3 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low |
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
145000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
2600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
10800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isopropanol |
- |
|
106 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.01 X 1003 |
Calculated |
- |
|
3.7 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.55 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
3.79 X 10-02 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low volatility |
|
3.60 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
3.5 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Non-persistent |
|
2.5 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Lab studies DT₅₀ range 2-3 days |
|
|
6.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 6.0-7.6 days, Strawberry fruit, n=2 |
|
|
23.3 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Grape berries, n=1 |
|
|
- |
- |
- |
|
- |
|
|
7.5 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
- |
|
7 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
7 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slightly mobile |
|
1100 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.38 |
Calculated |
Low leachability |
|
|
1.01 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
279 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
180 |
- |
|
- |
- |
- |
|
2226 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
890 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
16 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.01 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
0.42 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Scenedesmus subspicatus |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Low |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
1.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
0.3 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
Low risk to Europeans as no longer approved for use |
|
Low risk to Europeans as no longer approved for use |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H317, H319; H332 Environment: H400 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
dichlofluanid |
|
dichlofluanide |
|
Dichlofluanid |
|
dichlofluanid |
|
diclofluanide |
|
diclofluanid |
|
dichlofluanid |
|
dichlofluanid |
|
diklofluanid |
|
diklofluanid |
|
dichlofluanide |
|
- |