Dicamba isopropyammonium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
Human health Moderate alert: Possible Carcinogen; Possible Reproduction/development effects; Neurotoxicant
 |
|
A herbicide for control of annual and perennial broad-leaved weeds and brush species |
|
Bedstraw; Buttercup; Carpetwed; Cocklebur; Lambsquarters; Mallow; Goosefoot; Pigweed; Sowthistle; Velvetleaf; Knapweed; Teasel; Plantains; Bindweed; Thistles |
|
Cotton; Sugarcane; Soybeans; Sorghum; Asparagus; Grass seed crops; Non-cropland; Cereals including wheat, triticale, oats, maize, rye |
|
Shown to be efficiatious via field trials and extensive global use. |
|
Current |
|
circa 1963 |
|
Approved |
|
31/12/2029 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Denmark/Romania |
|
31/12/2023 |
|
No |
|
Yes - as dicamba |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
|
|
|
|
None |
|
C₁₁H₁₅Cl₂NO₃ |
|
CC(C)N.COC1=C(C=CC(=C1C(=O)O)Cl)Cl |
|
- |
|
DLUOWQZURZVAEN-UHFFFAOYSA-N |
|
InChI=1S/C8H6Cl2O3.C3H9N/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;1-3(2)4/h2-3H,1H3,(H,11,12);3H,4H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
Dicamba |
Parent |
 |
|
Herbicide, Plant Growth Regulator |
|
Benzoic acid herbicide; Benzoic acid PGR |
|
- |
|
EU dossier - None declared |
|
Synthetic |
|
Selective, systemic, absorbed through leaves and translocates throughout plant. Synthetic auxin. |
|
55871-02-8 |
|
No data found |
|
85 |
|
- |
|
24835137 |
|
607-043-00-X |
|
280.15 |
|
3,6-dichloro-2-methoxybenzoic acid—propan-2-amine (1/1) |
|
,6-dichloro-o-anisic acid - isopropylamine (1:1) |
|
3,6-dichloro-2-methoxybenzoic acid compound with 2-propanamine (1:1) |
|
Potential groundwater contaminant |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
- |
|
- |
|
Often supplied as a soluble concentrate that is mixed with water and applied as a spray |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegradable |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.3 |
as dicamba |
- |
|
0.3 |
as dicamba |
- |
|
0,3 |
as dicamba |
- |
|
0.3 |
as dicamba |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Negligible risk to bystanders |
|
No unacceptable risks to operators or other farm workers identified |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
0.1 |
EU Dir 89/778/EC limit as dicamba |
- |
|
Rapid and extensive elimination mainly via the urine |
|
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
|
|
|
Harmful if swallowed Possible liver toxicant May cause serious eye damage Evidence of thyroid parafollicular (C-cell) carcinoma in male rats May cause body weight effects |
|
|
|
Corrosive Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to autoignite; Not highly flammable |
|
- |
|
II (Moderately hazardous) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
dicamba isopropyammonium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |