Diafenthiuron (Ref: CGA 106630) |
(Also known as: CG 167; CGA 106630 ) |
Diafenthiuron is an insecticide and acaricide. It has a low aqueous solubility but is readily soluble in many organic solvents. It is volatile and, based on its chemical properties, it is unlikely to leach to groundwater. It is not persistent in most soil systems but may be very persistent in aquatic systems. It has a low mammalian toxicity but is moderate to highly toxic for most biodiversity including aquatic life, bees and worms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: GUS: Low leachability; Drainflow: Non-mobile; Potential for particle bound transport: Low
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 |
Human health Low alert
 Warning: Significant data are missing |
|
An insecticide and acaricide effective against phytophagous mites and other sucking pests |
|
Aphids; Whiteflies; Spidermites; Diamondback moth; thrips; Jassids |
|
Cotton; Fruit trees; Ornamentals; Soybeans |
|
- |
|
Current |
|
1988, first reported; 1990, first marketed |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia, Asia Pacific, Latin America |
|
None |
|
C₂₃H₃₂N₂OS |
|
CC(C)C1=CC(=CC(=C1NC(=S)NC(C)(C)C)C(C)C)OC2=CC=CC=C2 |
|
- |
|
WOWBFOBYOAGEEA-UHFFFAOYSA-N |
|
InChI=1S/C23H32N2OS/c1-15(2)19-13-18(26-17-11-9-8-10-12-17)14-20(16(3)4)21(19)24-22(27)25-23(5,6)7/h8-16H,1-7H3,(H2,24,25,27) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
diafenthiuron |
- |
 |
|
Insecticide, Acaricide, Miticide |
|
Thiourea insecticide; Urea insecticide; Thiourea acaricide; Urea acaricide |
|
- |
|
- |
|
Synthetic |
|
Broad spectrum, contact and stomach action with some ovicidal activity, acts by inhibiting oxidative phosphorylation. Inhibitor of mitochondrial ATP synthase. |
|
80060-09-9 |
|
616-885-7 |
|
8097 |
|
- |
|
3034380 |
|
No data found |
|
384.58 |
|
N-tert-butyl-N'-[2,6-di(propan-2-yl)-4-phenoxyphenyl]carbonothioic diamide |
|
1-tert-butyl-3-(2,6-diisopropyl-4-phenoxyphenyl)thiourea |
|
N-(2,6-bis(1-methylethyl)-4-phenoxyphenyl)-N'-(1,1-dimethylethyl)thiourea |
|
PAN Listed as Highly Hazardous Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
12A |
|
Not applicable |
|
None identified |
|
White powder |
|
|
|
- Syngenta
- Nanjing Essence Fine-Chemicals Co. Ltd
|
|
|
|
Often supplied as suspension concentrates or wettable powders |
|
|
|
|
|
0.06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
43000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
320000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
33000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
9600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
|
146 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.75 X 1005 |
Calculated |
- |
|
5.76 |
Z3 Z = Kingtai Chemials website (click here ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.09 |
Z3 Z = Kingtai Chemials website (click here ) 3 = Unverified data of known source |
- |
|
Not applicable |
Z3 Z = Kingtai Chemials website (click here ) 3 = Unverified data of known source |
- |
No dissociation |
|
0.002 |
|
Low volatility |
|
1.28 X 10-02 |
|
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
0.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data suggests DT₅₀ 1 hour to 1.5 days (Z3) |
|
|
3.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Chinese cabbage leaves, undercover, n=1 |
|
|
3.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 2.4-4.3 days, 3.0 field & undercover grown crops, various matrices, n=3 |
|
|
- |
- |
- |
|
Stable to UV light |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
pH variable: 4 years at pH 5, 451 days at pH 7, 796 days at pH 9, all at 20 °C |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
43546 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.19 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Low |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
2068 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
4 |
- |
|
- |
- |
- |
|
1500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
1.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
2.1 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Moderately harmful at dose 500 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Aphidius rhopalosiphi |
- |
|
Harmless at dose 500 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.0007 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
> 0.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
2068 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.558 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
Acute percutaneous LD₅₀ > 2000 mg kg⁻¹ |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
PPC/PPE required to mitigate exposure risks |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Toxic if swallowed or inhaled Probable kidney toxicant |
|
|
|
Non-corrosive Not expected to autoignite; Not highly flammable |
|
Health: H373, H370, H330, H319, H302 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
diafenthiuron |
|
diafenthiuron |
|
Diafenthiuron |
|
diafenthiuron |
|
diafentiuron |
|
diafentiuron |
|
- |
|
diafentiuron |
|
- |
|
- |
|
- |
|
- |