DDD (Ref: ENT 4225) |
(Also known as: dichlorodiphenyldichloroethane; tetrachlorodiphenylethane; TDE; p,p'-DDD; ME-1700) |
DDD is a banned and obsolete insecticide that is also a metabolite of DDT. It is practically insoluble in water and is not highly volatile. It is, like DDT, very environmentally perssitent in both soils and water. It is toxic to humans through ingestion, inhalation and via skin absorption and has been linked with cancer, is mutagenic and various negative reproduction/fertility effects. It is also an endocrine disrupter. It is toxic to most animal species but data is not abundant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
A now obsolete insecticide that was formerly used to kill a wide range of insect pests especially those that carry disease. It is also a pesticide transformation product of DDT |
|
Mosquitoes; Lice |
|
Vegetables; Cotton; Peanuts; Forestry; Public health situations |
|
Not applicable |
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
1944, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Consists of three isomeric forms p,p'-DDD, o,p'-DDD and o,o'-DDD. p,p'-DDD is the dominant isomer. |
|
C₁₄H₁₀Cl₄ |
|
C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(Cl)Cl)Cl |
|
No data |
|
AHJKRLASYNVKDZ-UHFFFAOYSA-N |
|
InChI=1S/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
DDD |
- |
 |
|
Insecticide, Metabolite |
|
Soil, Groundwater |
|
Organochloride insecticide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic stomach and contact action |
|
72-54-8 |
|
200-783-0 |
|
199 |
|
029101 |
|
6294 |
|
No data found |
|
320.04 |
|
- |
|
1,1-dichloro-2,2-bis(4-chlorophenyl)ethane |
|
1,1'-(2,2-dichloroethylidene)bis(4-chlorobenzene) |
|
Common environmental pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
2A |
|
Not applicable |
|
- |
|
Clear to off-white coloured crystals |
|
|
|
|
|
0.09 |
|
Low |
|
- |
- |
- |
|
110 |
|
- |
|
350 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.05 X 1006 |
Calculated |
- |
|
6.02 |
|
High |
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
1.385 |
|
- |
|
Not applicable |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
No dissociation |
|
0.18 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low volatility |
|
4.0 X 10-06 |
|
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not considered to be biodegradeable. |
|
|
1000 |
|
Very persistent |
|
160 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Environmentally stable |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-mobile |
|
131000 |
|
Literature data ranges 130600 to 131800 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-2.46 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
113 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 4814 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.07 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
> 0.009 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
113 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
1200 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
Percutaneous LD₅₀ > 10000 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I |
- |
- |
|
|
Risk from residues in food but the substance is now banned |
|
PPE/PPC essential |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
US drinking water standards are variable by State: Minnesota 1.0 µg l⁻¹, Florida 0.1 µg l⁻¹ |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Moderately toxic by ingestion, inhalation and skin absorption Endocrine issues - Competitive binding to androgen receptors Whilst DDD is linked with cancer one particular isomeric form (o,p'-DDD) has been used to treat cancer of the adrenal gland |
|
|
|
Combustible Incompatible with alkalis, strong oxidisers Not expected to autoignite IMDG Transport Hazard Class 6.1 |
|
Health: H301, H312, H351 Environment: H400, H401 |
|
Not classified: Obsolete |
|
UN2761 |
|
- |
|
- |
|
|
|
DDD |
|
TDE |
|
TDE |
|
TDE |
|
TDE |
|
TDE |
|
- |
|
dichlorodifenylodichloroetan |
|
- |
|
- |
|
TDE |
|
- |