Dazomet-sodium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Reproduction/development effects
 |
|
A multi-purpose, non-selective pre-plant soil fumigant |
|
Nematodes; Soil fungi; Soil insects including wireworms, cutworms; Weed seeds |
|
Golf-greens; Turf; Ornamentals; Nursery sites; Potting soil; Strawberry plots; Tomatoes; Tobacco |
|
- |
|
Current |
|
1967, first registered USA |
|
Approved |
|
31/05/2026 |
|
No data |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Belgium/Netherlands |
|
31/05/2023 |
|
No |
|
Yes - as dazomet |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
|
✓ |
✓ |
|
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
✓ |
✓ |
✓ |
|
✓ |
|
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
|
|
|
|
None |
|
C₅H₁₁N₂NaS₂ |
|
CN1CN(C(=S)S[CH-]1)C.[Na+] |
|
- |
|
RNDANRCVXXZHMY-UHFFFAOYSA-M |
|
InChI=1S/C5H12N2S2.Na/c1-6-3-7(2)5(8)9-4-6;/h5,8H,3-4H2,1-2H3;/q;+1/p-1 |
|
Yes |
|
Insecticide, Fungicide, Herbicide, Fumigant |
|
Dithiocarbamate insecticide; Carbamate insecticide; Dithiocarbamate herbicide; Carbamate herbicide; Dithiocarbamate fungicide; Carbamate fungicide; Fumigant pesticide |
|
- |
|
- |
|
Synthetic |
|
Releases methyl isothiocyanate. Multi-site activity. |
|
53404-60-7 |
|
No data found |
|
146 |
|
- |
|
23690887 |
|
613-008-00-X |
|
186.27 |
|
sodium 3,5-dimethyl-1,3,5-thiadiazinane-2-thiolate |
|
sodium 3,5-dimethyl-1,3,5-thiadiazinane-2-thiolate |
|
sodium 3,5-dimethyl-1,3,5-thiadiazinane-2-thiolate |
|
- |
|
- |
|
Not known |
|
Not known |
|
8F |
|
Not known |
|
- |
|
Colourless crystalline solid |
|
|
|
|
|
- Certis
- BASF
- Stauffer
- Union Carbide
- Hopkins Agriculture
|
|
- Basamid Granules
- Mico-Fume
- Mylone
|
|
Often supplied in granule formulations applied directly to the soil surface causing methyl isothiocyanate to be released. |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.27 X 1000 |
Calculated |
- |
|
0.63 |
as dazomet |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Not applicable |
|
- |
No dissociation |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
415 |
Rat as dazomet |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 415 |
Colinus virginianus as dazomet |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
415 |
Rat as dazomet |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.01 |
Rat SF=100 as dazomet |
- |
|
0.03 |
Rat SF=100 as dazomet |
- |
|
- |
- |
- |
|
0.015 |
Rat SF=100 as dazomet |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
No unacceptable risks to bystanders identified |
|
No unacceptable risks to operators or other workers identified |
|
|
EU MRL pesticide database |
|
|
|
|
|
GB MRL levels for some commodities subject to change in late 2021 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A2 A = Chromosome aberration (EFSA database) 2 = Mixed/ambiguous results ; B2 B = DNA damage/repair (EFSA database) 2 = Mixed/ambiguous results ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
Corrosive Prevent generation of dust Not explosive or oxidising IMDG TransportHazard Class 9 Not expected to autoignite; Not highly flammable |
|
Health: H302, H319 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2588 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
dazomet-sodium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |