Dalapon-sodium |
(Also known as: dalapon; proprop; DPA) |
Dalapon sodium is a selective herbicide. It is highly soluble in water and volatile. Based on its chemical properties it has a tendency to leach to groundwater. Data suggests it is moderately persistent in soil systems and can be persistent in some water systems. It is relatively non-toxic to mammals and has a low potential for bioaccumulation. Dalapon sodium is a recognised irritant. It has a moderate toxicity to most aquatic organisms and honeybees but is less harmful to birds and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
A herbicide used to control annual and perennial grasses including couch |
|
Bluegrass; Crabgrass; Quackgrass; Bermudagrass Johnsssongrass; Cattails; Rushes; Barnyardgrass; Couch |
|
Cotton; Fruit including currants, plums, apricots, cherries, citrus; Potatoes; Sugarcane; Carrots; Alfalfa; Asparagus; Flax; Lucerne; Non-crop situations including domestic houses, commerical and industrial sites |
|
- |
|
Current |
|
1954, first year of public use |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₃H₃Cl₂NaO₂ |
|
CC(C(=O)[O-])(Cl)Cl.[Na+] |
|
- |
|
PDEFQWNXOUGDJR-UHFFFAOYSA-M |
|
InChI=1S/C3H4Cl2O2.Na/c1-3(4,5)2(6)7;/h1H3,(H,6,7);/q;+1/p-1 |
|
Yes |
|
Herbicide |
|
Organochloride herbicide; Carboxylic acid herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic absorbed through leaves and roots. Inhibition of lipid synthesis. |
|
127-20-8 |
|
204-828-5 |
|
52 |
|
028902 |
|
517058 |
|
607-162-00-7 |
|
164.95 |
|
sodium 2,2-dichloropropanoate |
|
sodium 2,2-dichloropropionate |
|
sodium 2,2-dichloropropionate |
|
- |
|
- |
|
Z |
|
0 |
|
Not applicable |
|
Not applicable |
|
- |
|
Pale-coloured powder |
|
|
|
|
|
- Shell
- Dow Chemicals
- BASF
- Diamond Shamrock
|
|
- Radapon
- Dowpon
- basinex
- Revenge
- Alatex
- Ded-Weed
|
|
Usually supplied as a water-soluble powder |
|
|
|
|
|
629000 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
High |
|
110000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
369000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
3250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
|
166.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Decomposes |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.92 X 1000 |
Calculated |
- |
|
0.84 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low |
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
1.74 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
1.79 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Strong acid |
|
0.017 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
30 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source |
Moderately persistent |
|
30 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Stable |
|
Temperature sensitive, slow at 25 °C but quite rapid at 50 °C |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Very mobile |
|
1 |
|
Other sources: 2.34-151.4 mL g⁻¹ (R3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
5.91 |
Calculated |
High leachability |
|
|
2.86 X 1000 |
Calculated |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
9330 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
15 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
- |
- |
|
- |
- |
- |
|
5660 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Gallus domesticus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
1058 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 50 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
6 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
20 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Unknown species |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
9330 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible kidney toxicant |
|
|
|
No information available |
|
Health: H315, H318 Environment: H412 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
dalapon-sodium |
|
dalapon sodium |
|
Dalapon natrium |
|
dalapon natrium |
|
dalapon sodio |
|
dalapon sodio |
|
- |
|
dalapon sodowy |
|
- |
|
- |
|
dalapon natrium |
|
- |