Copper II carbonate |
(Also known as: cupric carbonate; copper monocarbonate) |
This is an inorganic copper based fungicide. It has a low aqueous solubility and a low volatility. It is highly toxic to fish and earthworms. It is moderately toxic to mammals via the oral route. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Non-persistent; GUS: Low leachability; Potential for particle bound transport: Low
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
An inorganic-copper fungicide, algicide and insecticide |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
CuCO₃ |
|
C(=O)([O-])[O-].[Cu+2] |
|
- |
|
GEZOTWYUIKXWOA-UHFFFAOYSA-L |
|
InChI=1S/CH2O3.Cu/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
|
Yes |
|
Fungicide |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
Protective, inhibiting fungal spores and pathogens from entering the host tissues. Multi-site activity. |
|
1184-64-1 |
|
214-671-4 |
|
- |
|
- |
|
14452 |
|
No data found |
|
123.55 |
|
copper II carbonate |
|
Copper carbonate |
|
copper II carbonate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
M01 |
|
- |
|
Green-blue Powder |
|
|
|
- Ingenieria Industrial, S.A. de C.V.
- Old Bridge Chemicals, Inc.
|
|
- Carbocob
- Carbocop
- Carboflow
|
|
Usually supplied as a spray-dried, powder. Both light and dense grades are available. |
|
|
|
|
|
0.000001 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
Low |
|
- |
- |
- |
|
200 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.55 X 10-01 |
Calculated |
- |
|
-0.81 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
3.9 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
1.00 X 10-10 |
Q1 Q = Miscellaneous data from online sources 1 = Estimated data with little or no verification |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Copper ion rapidly released in soil. Copper is a naturally occurring element and, as such, does not then degrade further. DT₅₀ of Cu >10,000 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Very mobile |
|
1 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-4.00 |
Calculated |
Low leachability |
|
|
7.34 X 10-04 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
|
Calculated |
- |
|
|
Low risk |
Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
15 |
Eisenia foetida as Cu 56 days |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 50 |
|
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.017 |
B2 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 2 = Unverified data of unknown source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
59.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data Chironomus riparius as mg Cu/kg |
Moderate |
|
- |
- |
- |
|
0.55 |
H1 H = The US ARS pesticide properties database. Dataset is no longer available. 1 = Estimated data with little or no verification Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
Statutory EU standard for total copper in drinking water: 2 mg l⁻¹; Non-statutory WHO guideline for total copper in drinking water: 2 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
2000 |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Potential heavy metal poisoning Pulmonary and hepatic toxin Harmful if swallowed or inhaled |
|
|
|
Prevent generation of dust |
|
Health: H302, H315, H319 Environment: H400, H410 |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
copper II carbonate |
|
carbonate de cuivre |
|
Kupfercarbonat |
|
cupricarbobat basisk |
|
carbonato di rame |
|
carbonato de cobre |
|
- |
|
weglan miedzi (II) |
|
- |
|
- |
|
- |
|
- |