Chlorphoxim (Ref: OMS 1197) |
(Also known as: chlorphoxime; Bayer 78182; BAY 78182; BAY SRA 7747) |
Chlorphoxim is an organophosphate insecticide. Little information is available regading its environmental fate It is highly toxic to birds but has a low fish toxicity. Mammalian toxicity is also considered to be low but chlorphoxim is a cholinesterase inhibitor and a neurotoxin. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity High alert: Birds acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
Chlorphoxim is an obsolete public health insecticide |
|
Mosquitoes; Midges; Flies; Fleas |
|
Public health situations; Doemstic residences |
|
- |
|
Considered obsolete but may be available in some countries |
|
1972, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric, Substance has one E/Z centre |
|
C₁₂H₁₄ClN₂O₃PS |
|
CCOP(=S)(OCC)ON=C(C#N)C1=CC=CC=C1Cl |
|
CCOP(=S)(OCC)O/N=C(/C#N)\C1=CC=CC=C1Cl |
|
GQKRUMZWUHSLJF-UHFFFAOYSA-N |
|
InChI=1S/C12H14ClN2O3PS/c1-3-16-19(20,17-4-2)18-15-12(9-14)10-7-5-6-8-11(10)13/h5-8H,3-4H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
chlorphoxim |
- |
 |
|
Insecticide |
|
Organophosphate insecticide; Organothiophosphate insecticide |
|
- |
|
- |
|
Synthetic |
|
Cholinesterase inhibition after conversion to the oxygen analogue |
|
14816-20-7 |
|
238-888-9 |
|
341 |
|
Not listed |
|
5360461 |
|
No data found |
|
332.74 |
|
O,O-diethyl ({[(?)-(2-chlorophenyl)cyanomethylidene]amino}oxy)phosphonothioate |
|
O,O-diethyl 2-chloro-α-cyanobenzylideneaminooxyphosphonothioate |
|
7-(2-chlorophenyl)-4-ethoxy-3,5-dioxa-6-aza-4-phosphaoct-6-ene-8-nitrile 4-sulfide |
|
PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Aedes aegypti, Anopheles albimanus, Anopheles vagus, Anopheles sacharovi, Culex quinquefasciatus, Simulium sanctipauli, Simulium squamosum, plus others |
|
White crystalline solid |
|
|
|
|
|
|
|
Usually supplied as a wettable powder |
|
|
|
|
|
1.7 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low |
|
- |
- |
- |
|
66.5 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.07 X 1005 |
Calculated |
- |
|
5.03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
1.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Bermuda grass leaves, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2500 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
50 |
Colinus virginianus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
120 |
Cyprinus carpio |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2500 |
Rat |
Low |
|
500 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
0.3 |
Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I |
- |
- |
|
|
Absorbed from gastrointestinal tract and skin |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
- |
|
U (Unlikely to present an acute hazard) |
|
UN2783 |
|
- |
|
- |
|
|
|
chlorphoxim |
|
chlorphoxime |
|
Chlorphoxim |
|
- |
|
- |
|
Clorfoxim |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |