Chlorfenapyr (Ref: MK 242) |
(Also known as: AC 303630; CL 303630) |
Chlorfenapyr is a broad spectrum insecticide. It has a low aqueous solubility, low volatility and, based on its chemical properties, would not normally be expected to leach to groundwater. It is not usually persistent in soil or water systems. It has a moderate mammalian oral toxicity but no other data on human health impact has been identified. There are also gaps in ecotoxicilogical data but it is know to be highly toxic to birds, fish and aquatic invertebrates. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute unknown ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High
 |
|
A proinsecticide used to control many insects and mites including those resistant to carbamate, organophosphate and pyrethroid compounds |
|
Spider mites; Caterpillars; Thrips; Fungus gnats; Public heakth applications including termites, cockroaches, ants, bedbugs, flies and spiders |
|
Greenhouse ornamentals |
|
- |
|
Current |
|
1996, first registered in Japan; 2001, first registered in USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Spain |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Noine |
|
C₁₅H₁₁BrClF₃N₂O |
|
CCOCN1C(=C(C(=C1C(F)(F)F)Br)C#N)C2=CC=C(C=C2)Cl |
|
- |
|
CWFOCCVIPCEQCK-UHFFFAOYSA-N |
|
InChI=1S/C15H11BrClF3N2O/c1-2-23-8-22-13(9-3-5-10(17)6-4-9)11(7-21)12(16)14(22)15(18,19)20/h3-6H,2,8H2,1H3 |
|
Yes |
|
Insecticide, Acaricide, Miticide |
|
Pyrrole insecticide; Pyrrole acaricide |
|
> 940 g kg⁻¹ |
|
- |
|
Synthetic |
|
Limited systemic activity, mainly stomach but some contact action. Uncoupler of oxidative phosphorylation. |
|
122453-73-0 |
|
602-782-4 |
|
570 |
|
129093 |
|
91778 |
|
608-034-00-3 |
|
407.62 |
|
4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
|
4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethyl-1H-pyrrole-3-carbonitrile |
|
4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
|
Chemical subject to PIC regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
13 |
|
Not applicable |
|
Earias vittella, Tetranychus urticae |
|
White powdery solid |
|
|
|
|
|
- BASF
- AgroCare
- FCC
- Nippon soda
|
|
- Pirate
- Pylon
- Shark
- Arg Chlorfenapyr Tgai
- Phantom Termiticide
- Kotetsu
|
|
Usually supplied as suspension concentrate |
|
|
|
|
|
0.112 |
at 25 °C |
Low |
|
8900 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Hexane |
- |
70900 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Methanol |
- |
754000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Toluene |
- |
1410000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Dichloromethane |
- |
|
101 |
|
- |
|
- |
- |
- |
|
183 |
|
- |
|
- |
- |
- |
|
|
1.62 X 1005 |
Calculated |
- |
|
5.21 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.53 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
Not applicable |
|
- |
No dissociation |
|
9.81 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low volatility |
|
5.81 X 10-04 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1.4 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
3.28 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 2.85-3.7 days, 3 crops, various matrices, n=3 |
|
|
3.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.4-7.0 days, 8 field and undercover grown crops, various matrices, n=11 |
|
|
6.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast |
|
- |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
Stable pH 4 to pH 9 |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
12000 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-0.01 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
- |
|
- |
|
Not available |
- |
Known groundwater metabolites |
|
None
|
|
|
|
|
2-(4-chlorophenyl)-5-hydroxyl-4-oxo-5-(trifluoromethyl)-3-pyrrole-3-carbonitrile (Ref: AC 325195) Note: Rat LD50 = 776 mg/kg bw |
- |
Animal |
- |
- |
2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl) -1H-pyrrole-3-carbonitrile (Ref: AC 312094) Note: Rat LD50 > 5000 mg/kg bw |
- |
Animal, Plant |
- |
- |
tralopyril (Ref: CL 303268) Note: Rat LD50 = 27 mg/kg bw |
4-bromo-2-(4-chlorophenyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
Animal, Plant |
- |
- |
4-bromo-2-(p-chlorophenyl)-5-(carboxylic)- pyrrole-3-carbonitrile (Ref: AC 322250) Note: Rat LD50 = 2500 mg/kg bw |
- |
Animal |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
45 |
Mouse |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.12 |
Apis mellifera |
High |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.007 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
> 0.00871 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Cyprinodon variegatus 33 day |
High |
|
0.0061 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
0.00357 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
45 |
Mouse |
High |
|
2000 |
Rabbit |
- |
|
1.9 |
Rat |
- |
|
- |
- |
- |
|
0.015 |
|
- |
|
0.015 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
Occupational exposure may occur through dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D3 D = Genome mutation (EFSA database) 3 = Negative ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Possile testicular and uterine toxicant USEPA - some evidence to suggest possible human carcinogen |
|
|
|
No information available |
|
Health: H302, H331 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
chlorfenapyr |
|
chlorfénapyr |
|
Chlorfenapyr |
|
chlorfenapyr |
|
clorfenapir |
|
clorfenapir |
|
chlorfenapyr |
|
chlorofenapir |
|
- |
|
- |
|
chloorfenapyr |
|
- |