Chlorfenac |
(Also known as: fenac; trifene) |
Chlorfenac is an obsolete herbicide for the control of annual weeds and grasses. It has a low aqueous solubility and ishighly volatile. It may be persistent in both soil and water systems. It is moderately toxic to aquatic fife but has a low toxicity to birds. It is moderately toxic to mammals if ingested. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 Warning: Significant data are missing |
|
An obsolete herbicide used to control annual weeds and grasses in sugarcane and non-cropped areas |
|
Dandelion; Nightshade; Docks; Plaintains; Foxtail; Purslane; Thistles; Nettles; Crabgrass |
|
Sugarcane; Non-cropped areas such as rights-of-way, rangeland; Submerged aquatic weeds |
|
- |
|
Considered obsolete but may be available in some countries |
|
Early 1960s, developed |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₈H₅Cl₃O₂ |
|
C1=CC(=C(C(=C1Cl)CC(=O)O)Cl)Cl |
|
- |
|
QZXCCPZJCKEPSA-UHFFFAOYSA-N |
|
InChI=1S/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
chlorfenac |
- |
 |
|
Herbicide |
|
Aromatic carboxylic acid compound; Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
Inhibits cell wall synthesis, Systemic, absorbed predominately by plant roots, with translocation. Auxin mimic. |
|
85-34-7 |
|
201-599-3 |
|
None allocated |
|
082601 |
|
6805 |
|
607-074-00-9 |
|
239.48 |
|
(2,3,6-trichlorophenyl)acetic acid |
|
(2,3,6-trichlorophenyl)acetic acid |
|
2,3,6-trichlorobenzeneacetic acid |
|
Risk of drift |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless solid |
|
|
|
- Amchem Products
- Rhone-Poulenc Agrochemic
- Hooker Chemical Company
- Union Carbide
|
|
- Fenatrol
- Trifene
- Fenac
- Tri-Fen
|
|
Usually supplied as granules or as an aqueous solution |
|
|
|
|
|
6.14 |
|
Low |
|
- |
- |
- |
|
156 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.58 X 1003 |
Calculated |
- |
|
3.2 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.57 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
3.7 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Weak acid |
|
1100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
180 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
USDA data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Stable |
|
Stable at pH 5, 7 and 9 |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
400 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.15 |
Calculated |
High leachability |
|
|
4.12 X 10-01 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 576 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 7.50 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
> 4.50 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
19.16 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlamydomonas moewusii 7 day |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 576 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
1440 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Harmful if swallowed May disturb body temperature regulation May cause hypotension |
|
|
|
Not expected to autoignite; Not highly flammable |
|
Health: H302 Environment: H411 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
chlorfenac |
|
chlorfenac |
|
Chlorfenac |
|
- |
|
- |
|
clorfenac |
|
- |
|
chlorofenak |
|
- |
|
- |
|
- |
|
- |