Chlorethoxyfos (Ref: DPX 43898) |
(Also known as: chlorethoxyphos; WL 208304; SD 208304) |
Chlorethoxyfos is an organophosphate insecticide. It has a low aqueous solubility and, based on its chemical properties, it should not leach to groundwater. It is not persistent in soil systems but may be moderately persistent in aqueous systems under certain conditions. It is highly toxic to humans and there is some concern that it may bioaccumulate. It is highly toxic to most aquatic life, honey bees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute contact ecotoxicity: High; Earthworms acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An organophosphate insecticide used to control soil pests |
|
Corn rootworm; Cutworms; Wireworms; Seed maggots; White grubs; Symphylans |
|
Corn; Row crops; Forage; Small grains |
|
- |
|
- |
|
circa 1995, USA |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
C₆H₁₁Cl₄O₃PS |
|
CCOP(=S)(OCC)OC(C(Cl)(Cl)Cl)Cl |
|
No data |
|
XFDJMIHUAHSGKG-UHFFFAOYSA-N |
|
InChI=1S/C6H11Cl4O3PS/c1-3-11-14(15,12-4-2)13-5(7)6(8,9)10/h5H,3-4H2,1-2H3 |
|
Yes |
|
Insecticide |
|
Organophosphate insecticide; Organothiophosphate insecticide |
|
- |
|
- |
|
Synthetic |
|
Cholinesterase inhibitor, vapour action |
|
54593-83-8 |
|
611-172-7 |
|
None allocated |
|
129006 |
|
91655 |
|
No data found |
|
336.0 |
|
rac-O,O-diethyl O-[(1R)-1,2,2,2-tetrachloroethyl] phosphorothioate |
|
O,O-diethyl (RS)-O-(1,2,2,2-tetrachloroethyl) phosphorothioate |
|
O,O-diethyl O-(1,2,2,2-tetrachloroethyl) phosphorothioate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
None identified |
|
Gray to brown granules formulated as a liquid |
|
|
|
- Amvac Chemical Corp
- Du Pont de nemours
|
|
|
|
Usually supplied in a granular formulation and with tamper-proof delivery systems (SmartBox) |
|
|
|
|
|
0.1 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
80 |
|
- |
|
- |
- |
- |
|
230 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
9.33 X 1003 |
Calculated |
- |
|
3.97 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.64 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
7.67 X 10-03 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
21 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-persistent |
|
13.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
3 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data; DT₅₀ USA range 1-23 days; Lab studies 7 days sandy loam and 20 days loam (L3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
27 |
|
Slow |
|
- |
|
|
59 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
pH sensitive: DT₅₀ 4.3 days at pH 5, 72 days pH 9 |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
6100 |
|
Medium of 4 soil types; Other data source: 9000 mL g⁻¹ (DW3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.10 |
Calculated |
Low leachability |
|
|
1.03 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
2500 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Threshold for concern |
|
Not available |
- |
|
|
|
|
|
Major fraction |
0.5 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
1.8 |
Rat |
High |
|
|
25 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
486 |
Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.39 |
|
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
0.04 |
Apis mellifera |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.089 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Oncorhynchus mykiss |
High |
|
0.00028 |
Cyprinodon variegatus |
High |
|
0.00041 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
0.000032 |
Daphnia magna |
High |
|
0.000054 |
Americamysis bahia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
1.8 |
Rat |
High |
|
20 |
Rat |
- |
|
0.58 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
Percutaneous LD₅₀ > 12.5 mg kg⁻¹ |
Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I |
- |
- |
|
|
Dietary risks from food and drinking water are not of concern |
|
PPE/PPC required to mitigate expsoure risks |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly toxic Chronic exposure may cause respiratory paralysis and death |
|
|
|
IMDG Transport Hazard Class 6.1, Flammable |
|
Health: H301, H310, H319, H330 Environment: H400, H410 |
|
Ia (Extremely hazardous) |
|
UN3017 |
|
- |
|
- |
|
|
|
chlorethoxyfos |
|
chlorethoxyfos |
|
Chlorethoxyfos |
|
chlorethoxyfos |
|
clorethoxyfos |
|
cloretoxifos |
|
- |
|
chloretoksyfos |
|
- |
|
- |
|
- |
|
- |