Chloramben (Ref: ACP M-629) |
(Also known as: amben; chlorambene) |
Chloramben is an obsolete pre-emergence herbicide. It is highly soluble in water, volatile, mobile and has a tendency to leach to groundwater. It is not normally persistent in soil or water systems. It has a low mammalian toxicity but a high potential for bioaccumulation. It is a recognised irritant and there are concerns that it may be a developmental/reproduction toxicant. Chloramben has a low toxicity to birds and aquatic invertebrates but is moderately toxic to fish and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate
 |
Human health High alert: Carcinogen
 |
|
An obsolete pre-emergence herbicide once used to control annual grass and broad-leaved weed seedlings |
|
barnyardgrass; Carpteweed; Chickweed; Crabgrass; Foxtail; Johnsongrass; Lambsquarter; Nightshade; Pigweed; Ragweed; Sinkgrass; Velvetleaf |
|
Soybeans; Peanuts; Vegetables including dry beans, lima beans, asparagus, pumpkins, squash; Corn; Tomatoes; Peppers, Sweet potatoes |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1958 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₇H₅Cl₂NO₂ |
|
C1=C(C=C(C(=C1N)Cl)C(=O)O)Cl |
|
No data |
|
BORCLYSCBJR-UHFFFAOYSA-N |
|
InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3/h1-2H,10H2,(H,11,12) |
|
Yes |
|
Herbicide |
|
Benzoic acid herbicide |
|
- |
|
- |
|
Synthetic |
|
Synthetic auxin, Selective, systemic, inhibits seedling root development |
|
133-90-4 |
|
205-123-5 |
|
141 |
|
029901 |
|
8630 |
|
No data found |
|
206.03 |
|
3-amino-2,5-dichlorobenzoic acid |
|
3-amino-2,5-dichlorobenzoic acid |
|
3-amino-2,5-dichlorobenzoic acid |
|
- |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystals |
|
|
|
|
|
- Amchem Products
- Bayer AG
- Union Carbide
|
|
- Ornamental Weeder
- Vegiben
- Amiben
|
|
Supplied in a varaiety of formulations including granules, soluble liquids and powders. |
|
|
|
|
|
700 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
172000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ethanol |
- |
233000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Acetone |
- |
200 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Benzene |
- |
900 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Chloroform |
- |
|
200 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.94 X 1001 |
Calculated |
- |
|
1.9 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
3.4 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Weak acid |
|
930 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Highly volatile |
|
3.92 X 10-06 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
14 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available other data: DT₅₀ given as approximately 6 to 8 weeks (CA3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.25 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Fast |
|
Rapid circa 6 hours |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Mobile |
|
21 |
|
Other sources: Koc range 21-190 mL g⁻¹ (CA3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.07 |
Calculated |
High leachability |
|
|
1.64 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
10000 |
- |
|
- |
- |
- |
|
4640 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
14.5 |
|
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
10 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
1000 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
In mammals it is excreted through the urine and expired air |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Slightly toxic May cause dermatitis |
|
|
|
No information available |
|
Health: H315, H319, H335, H350 |
|
Not classified: Obsolete |
|
- |
|
- |
|
- |
|
|
|
chloramben |
|
chlorambene |
|
Chloramben |
|
chloramben |
|
cloramben |
|
cloramben |
|
- |
|
chloramben |
|
- |
|
- |
|
- |
|
- |