Carfentrazone |
(Also known as: F8426-chloropropionic acid; F8426 CPA) |
Carfentrazone is a herbicide, normally applied as the ethyl variant, used to control a wide range of broad-leaved weeds. It is not expected to be persistent in the environment. Little data is available for the acid regarding its ecotoxicology or impacts on environmental health. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Non-persistent
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate; Earthworms chronic ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
A post-emergent herbicide, normally applied as the ethyl variant, used to control a wide range of broad-leaved weeds. |
|
Broad-leaved weeds including Galium aparine, Abutilon theophrasti, Ipomoea ederacea, Chenopodium album and several mustard species, Sedges, Silvery-thread moss |
|
Potatoes; Cereals including barley, oats, tritical, wheat and durum wheat; Sports turf & golf-coures |
|
- |
|
Current |
|
1997 |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Belgium/France |
|
31/07/2033 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
|
|
✓ |
✓ |
|
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
|
✓ |
|
|
|
|
Carfentrazone is a chiral molecule. The technical material is an isomeric mixture. |
|
C₁₃H₁₀Cl₂F₃N₃O₃ |
|
CC1=NN(C(=O)N1C(F)F)C2=C(C=C(C(=C2)CC(C(=O)O)Cl)Cl)F |
|
- |
|
YHKBGVDUSSWOAB-UHFFFAOYSA-N |
|
InChI=1S/C13H10Cl2F3N3O3/c1-5-19-21(13(24)20(5)12(17)18)10-3-6(2-8(15)11(22)23)7(14)4-9(10)16/h3-4,8,12H,2H2,1H3,(H,22,23) |
|
Yes |
|
Herbicide, Metabolite |
|
Soil, Rat, Surface water |
|
Triazolone herbicide |
|
- |
|
- |
|
Synthetic |
|
Contact, absorbed by foliage with limited translocation. Cell membrane disruption - PPO inhibitor. |
|
128621-72-7 |
|
603-289-7 |
|
587 |
|
628712 |
|
443229 |
|
607-309-00-5 |
|
384.13 |
|
rac-(2R)-2-chloro-3-(2-chloro-5-(4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl)-4-fluorophenyl)propanoic acid |
|
(RS)-2-chloro-3-(2-chloro-5-(4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl)-4-fluorophenyl)propionic acid |
|
α,2-dichloro-5-(4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl)-4-fluorobenzenepropanoic acid |
|
- |
|
- |
|
E |
|
14 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- Ally Express
- Lexus Class
- Carfen
|
|
Usually supplied as wettable granules or emulsions that are mixed with water and applied as a spray. |
|
|
|
|
|
29.3 |
as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.01 X 1003 |
Calculated |
- |
|
3.7 |
as ethyl variant |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
7.20 X 10-03 |
as ethyl variant |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
12.4 |
|
Non-persistent |
|
8.2 |
|
Non-persistent |
|
43.0 |
|
Moderately persistent |
|
31.7 |
|
- |
|
- |
- |
- |
|
EU dossier lab studies DT₅₀ range 3.5-59.3 days (normalised), DT₉₀ range 21.5-236.1 days; field studies DT₅₀ range 3-14.3 days, DT₉₀ range 9.8-51.6 days |
|
|
14.2 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Tall fescue grass, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat as ethyl variant |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
Colinus virginianus as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 410 |
Eisenia foetida as ethyl variant |
Moderate |
|
17.72 |
Eisenia foetida as ethyl variant |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 200 |
Apis mellifera as ethyl variant |
Low |
|
> 200 |
Apis mellifera as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 99.2 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
> 101 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.27 |
Lemna minor |
Moderate |
|
0.787 |
Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat as ethyl variant |
Low |
|
4000 |
Rat as ethyl variant |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.03 |
as ethyl variant |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
0.4 |
as ethyl variant |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No information available |
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 9 |
|
Environment: H400, H410 |
|
- |
|
- |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
carfentrazone |
|
carfentrazone |
|
Carfentrazone |
|
carfentrazone |
|
carfentazone |
|
carfentrazona |
|
carfentrazone |
|
karfentrazon |
|
karfentrazon |
|
karfentrazon |
|
carfentrazone |
|
- |