Carbophenothion (Ref: ENT 23708) |
(Also known as: carbofenotion; R-1303; Stauffer R-1,303) |
Carbophenothion is an insecticide used on a broad range of crops. The substance has a low aqueous solubility, low volatility and, based on its chemical propeerties, would not be expected to leach to groundwater. It may be quite persistent in soil systems. It is highly toxic to mammals and may also be a cholinesterase inhibitor and a neurotoxin. In most instances it shows a moderate to high level of toxicity to aquatic and terrestrial species. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An obsolete insecticide and acaricide once used to control pests on fruit and other crops. It is used to control parasites on animals. |
|
Aphids; Spider mites; Mealybugs; Weevils; Leaf hoppers; Armyworms |
|
Fruit including citrus, pears, apples; Cotton; Nuts; Vegetables; Sorghum; Maize; Sugarbeet |
|
- |
|
Considered obsolete but may be available in some countries |
|
1955, USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₁₆ClO₂PS₃ |
|
CCOP(=S)(OCC)SCSC1=CC=C(C=C1)Cl |
|
No data |
|
VEDTXTNSFWUXGQ-UHFFFAOYSA-N |
|
InChI=1S/C11H16ClO2PS3/c1-3-13-15(16,14-4-2)18-9-17-11-7-5-10(12)6-8-11/h5-8H,3-4,9H2,1-2H3 |
|
Yes |
|
Insecticide, Acaricide |
|
Organophosphate insecticide; Organothiophosphate insecticide; Organophosphate acaricide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Contact and stomach action with long residual activity. Acetylcholineesterase inhibitor. |
|
786-19-6 |
|
212-324-1 |
|
140 |
|
058102 |
|
13081 |
|
015-044-00-6 |
|
342.9 |
|
S-{[(4-chlorophenyl)sulfanyl]methyl} O,O-diethyl phosphorodithioate |
|
S-4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate |
|
S-(((4-chlorophenyl)thio)methyl) O,O-diethyl phosphorodithioate |
|
Severe Marine Pollutant; PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Panonychus citri, Tetranychus mcdanieli, Tetranychus viennensis, Boophilus microplus, plus others |
|
Yellow/brown liquid |
|
|
|
|
|
- Oleoakarithion
- Garrathion
- Acarithion
- Danifos
- Trithion
- Atlas Trithion
|
|
Available in several formulations including dusts |
|
|
|
|
|
0.34 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ethanol |
- |
Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Acetone |
- |
Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Xylene |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.62 X 1004 |
Calculated |
- |
|
4.75 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.27 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
1.07 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
5.80 X 10-01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
100 |
G2 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 2 = Unverified data of unknown source |
Persistent |
|
- |
- |
- |
|
30 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
4.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 4.5-4.6 days, Orange leaves, various matrices, n=2 |
|
|
11.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Published literature RL₅₀ range 5.1-18.5 days, 2 citrus crops, various matrices, n=3 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
50000 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.03 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
10 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
0.5 |
G2 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 2 = Unverified data of unknown source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
121 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
< 1.4 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
0.162 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
Contact |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.056 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
High |
|
0.0063 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Pimephales promelas |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.025 |
Americamysis bahia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
10 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.0005 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
May be absorbed through the skin - PPE/PPC required |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
The majority is excreted in urine and faeces within 72 hours |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
Prevent mist formation IMDG Transport Hazard Class 6.1 |
|
Health: H301, H311 Environment: H400, H410 |
|
Not classified: Obsolete |
|
UN3018 |
|
- |
|
- |
|
|
|
carbophenothion |
|
carbophenothion |
|
Carbophenothion |
|
carbophenothion |
|
carbofenotion |
|
carbofenotion |
|
carbophenothion |
|
karbofenotion |
|
- |
|
- |
|
carbofenothion |
|
- |