Captafol (Ref: Ortho-5865) |
(Also known as: captofol; difolatan; merpafol) |
Captafol is a broad spectrum fungicide. It has a low aqueous solubility, is non-volatile and, based on its chemical properties, would not normally be expected to leach to groundwater. It is not persistent in soil or water systems. Captafol has a low mammalian toxicity and is not expected to bioaccumulate. It is reported as a carcinogen and irritant. It is moderately toxic to birds, honeybees, earthworms and most aquatic organisms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Carcinogen
 |
|
A broad-spectrum phthalimide, contact fungicide often used to control diseases of fruit and other crops |
|
Foliage and fruit fungal diseases |
|
Fruit including apples, citrus, cranberry, blueberry, prunes, stone fruit; Potatoes; Tomatoes; Coffee; Peanuts; Onions; |
|
- |
|
- |
|
circa 1962 |
|
Not approved |
|
Expired/Banned |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired/Banned |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric, existing in the cis- and trans-forms |
|
C₁₀H₉Cl₄NO₂S |
|
C1C=CCC2C1C(=O)N(C2=O)SC(C(Cl)Cl)(Cl)Cl |
|
- |
|
JHRWWRDRBPCWTF-UHFFFAOYSA-N |
|
InChI=1S/C10H9Cl4NO2S/c11-9(12)10(13,14)18-15-7(16)5-3-1-2-4-6(5)8(15)17/h1-2,5-6,9H,3-4H2 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
captafol |
Unstated isomer |
 |
|
Fungicide |
|
Phthalimide fungicide |
|
- |
|
- |
|
Synthetic |
|
Acts by inhibiting the germination of spores. Multi-site activity. |
|
2425-06-1 |
|
219-363-3 |
|
185 |
|
081701 |
|
17038 |
|
613-046-00-7 |
|
349.06 |
|
2-[(1,1,2,2-tetrachloroethyl)sulfanyl]-3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione |
|
N-(1,1,2,2-tetrachloroethylthio)cyclohex-4-ene-1,2-dicarboximide |
|
3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]-1H-isoindole-1,3(2H)-dione |
|
Chemical subject to PIC regulations; Rotterdam Convention (Class Ia); PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
M04 |
|
- |
|
Colourless/yellow crystals |
|
|
|
- Scotts Company
- Chevron
- Makhteshim Agan
- Pillar International
|
|
- Merpafol
- Crisfolatan
- Folcid
- Difolatan
- Haipen
- Sanspor
|
|
Available in a variety of formulations including dusts, wettable powders, aqueous suspensions and suspension concentrates |
|
|
|
|
|
1.4 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
25000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
17000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
100000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
43000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
|
161 |
|
- |
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
161 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
6.76 X 1003 |
Calculated |
- |
|
3.83 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
1.30 X 10-09 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
3.30 X 10-01 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
39 |
|
Moderately persistent |
|
- |
- |
- |
|
7.0 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
FAO state DT₅₀ 23-55 days; Other literature values DT₅₀ range from 2-11 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Rapidly hydrolysed in acidic and alkaline conditions |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
2000 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.59 |
Calculated |
Low leachability |
|
|
6.88 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
27 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
|
tetrahydrophthalimidic acid |
- |
Animal |
- |
- |
dichloroactetic acid |
- |
Animal |
- |
- |
phthalic acid |
- |
Animal |
- |
- |
ammonia |
- |
Animal |
- |
- |
tetrahydrophthalimide |
THPI |
Animal |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
> 5500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
500 |
- |
|
- |
- |
- |
|
> 2510 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 351 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 96.7 |
72 Hr |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
> 0.25 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Cyprinidae 13 day |
Moderate |
|
> 3.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
5000 |
Rat |
- |
|
0.72 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Contact dermatitis, severe irritation of the respiratory tract, eye damage and other systemic effects are reported |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
IARC group 2A carcinogen; USEPA - probable human carcinogen May cause dermatitis May cause conjunctivitis and periorbital edema |
|
|
|
Corrosive to metals Avoid generation of dust |
|
Health: H317, H350 Environment: H400, H410 |
|
Ia (Extremely hazardous) |
|
- |
|
- |
|
- |
|
|
|
captafol |
|
captafole |
|
Captafol |
|
captafol |
|
captafol |
|
captafol |
|
- |
|
kaptafol |
|
- |
|
- |
|
captafol |
|
- |