Butamifos (Ref: S-2846) |
(Also known as: metacrefos) |
Butamifos is an organophosphate herbicide used to control annual and graminaceous weeds. It has a low aqueous solubility but other emvironmenal fate related data is scarce. Generally, butamifos is moderately toxic to biodiversity. It is also moderately toxic to mammals if ingested and is thought to be an acetyl cholinesterase inhibitor. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Acetyl cholinesterase inhibitor
 Warning: Significant data are missing |
|
An organophosphate herbicide used to control annual and graminaceous weeds |
|
Fathen; Groundsel; Wild oats; Wild canary grass; Brome; Crowsfoot grass; Nettles |
|
Lawns; Rice; Vegetables including beans, onions; Cereals including barley, wheat; Beet crops; Strawberries |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Butamifos is a chiral molecule. The technical material is a mixture of the R- and S-isomers. |
|
C₁₃H₂₁N₂O₄PS |
|
CCC(C)NP(=S)(OCC)OC1=C(C=CC(=C1)C)[N+](=O)[O-] |
|
No data |
|
OEYOMNZEMCPTKN-UHFFFAOYSA-N |
|
InChI=1S/C13H21N2O4PS/c1-5-11(4)14-20(21,18-6-2)19-13-9-10(3)7-8-12(13)15(16)17/h7-9,11H,5-6H2,1-4H3,(H,14,21) |
|
Yes |
|
Herbicide |
|
Organophosphate herbicide |
|
- |
|
- |
|
Synthetic |
|
Microtubule assembly inhibition. Non-systemic, selective |
|
36335-67-8 |
|
609-231-7 |
|
None allocated |
|
Not listed |
|
37419 |
|
No data found |
|
332.36 |
|
(E)-[O-ethyl O-(5-methyl-2-nitrophenyl) (2E)-butan-2-ylphosphoramidothioate] |
|
(RS)-{O-ethyl O-6-nitro-m-tolyl [(RS)-sec-butyl]phosphoramidothioate} |
|
O-ethyl O-(5-methyl-2-nitrophenyl) (1-methylpropyl)phosphoramidothioate |
|
PAN Bad Actor Chemical |
|
- |
|
K1 |
|
3 |
|
Not applicable |
|
Not applicable |
|
- |
|
Liquid |
|
|
|
|
|
- Cremart
- Hercules 26905
- Tufler
|
|
Usually supplied as emulsifiable concentrates and granules |
|
|
|
|
|
6.19 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
25 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
422 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.17 X 1004 |
Calculated |
- |
|
4.62 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
630 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
4.1 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
1.56 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.025 |
Selenastrum capricornutum |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
630 |
Rat |
Moderate |
|
5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
> 1.2 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Harmful if swallowed |
|
|
|
No information available |
|
- |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
butamifos |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |