Butafenacil (Ref: CGA 276854) |
(Not known by any other names) |
Butafenacil is a herbicide used to control annual and perennial broad-leaved weeds. Iit has a low aqueous solubility and a low volatility. It is not usually persistant in soil systems but may be moderately persistent in aquatic systems, depending on local conditions. It is moderraely toxic to honeybees and most aquatic species but less so to birds and earthworms. It has a low oral mammalian toxicity and is an irritant, |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health Low alert
 |
|
Used to control annual and perennial broad-leaved weeds in fruit and other crops |
|
Annual ryegrass; Capeweed; Clover; Sowthistle; Field beans; Poppies; Prickly lettuce; Wild radish; Rocket; Paradoxa grass; Fathen; Bermudagrass |
|
Cotton; Fruit including apples, pears, citrus, plums, apricots, cherries, grapes; Garlic & onions; Non-cropped land; Cereals incuding wheat |
|
- |
|
Current |
|
circa 2000 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia; Argentina; Brazil; Japan; Thailand |
|
None |
|
C₂₀H₁₈ClF₃N₂O₆ |
|
CC(C)(C(=O)OCC=C)OC(=O)C1=C(C=CC(=C1)N2C(=O)C=C(N(C2=O)C)C(F)(F)F)Cl |
|
- |
|
JEDYYFXHPAIBGR-UHFFFAOYSA-N |
|
InChI=1S/C20H18ClF3N2O6/c1-5-8-31-17(29)19(2,3)32-16(28)12-9-11(6-7-13(12)21)26-15(27)10-14(20(22,23)24)25(4)18(26)30/h5-7,9-10H,1,8H2,2-4H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
butafenacil |
- |
 |
|
Herbicide |
|
Uracil herbicide; Phenyluracil herbicide |
|
- |
|
- |
|
Synthetic |
|
Inhibitor of protoporphyrinogen oxidase (PPO), non-selective, contact action absorbed by foliage. |
|
134605-64-4 |
|
603-837-4 |
|
None allocated |
|
122004 |
|
11826859 |
|
No data found |
|
474.81 |
|
2-methyl-1-oxo-1-(prop-2-en-1-yloxy)propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]benzoate |
|
1-(allyloxycarbonyl)-1-methylethyl 2-chloro-5-[1,2,3,6-tetrahydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate |
|
1,1-dimethyl-2-oxo-2-(2-propenyloxy)ethyl 2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]benzoate |
|
- |
|
- |
|
E |
|
14 |
|
Not applicable |
|
Not applicable |
|
- |
|
Fine white to grey powder |
|
|
|
|
|
- Logran B-Power Herbicide
- Touchdown B-Power
- Inspire EC
|
|
Usually supplied as water dispersible granules and emulsifiable concentrates |
|
|
|
|
|
10.0 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
- |
- |
- |
|
113 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
270 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
293 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
- |
- |
- |
|
|
1.58 X 1003 |
Calculated |
- |
|
3.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.37 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
- |
- |
- |
- |
|
7.4 X 10-06 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
3.5 X 10-07 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Australian registration dossier states DT₅₀ 0.2-2.2 days aerobic soils, slower in water logged, anaerobic soils |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Slow |
|
- |
|
|
98 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
|
27 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Fast |
|
Slow, DT50 25-30 days |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Slow, DT50 25-30 days |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderately mobile |
|
365 |
|
Literature values for Koc range 149-581 mL g⁻¹ in four soils |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.25 |
Calculated |
Low leachability |
|
|
5.84 X 10-04 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
|
|
|
|
|
- |
- |
- |
|
Major fraction |
0.780 |
- |
|
- |
- |
Aerobic |
Known groundwater metabolites |
|
None
|
|
|
|
|
- Note: Very persistent |
CGA 98166 |
Water |
- |
- |
Ref: 1165 |
CGA 293730 |
Plant |
- |
- |
- |
CGA 380963 |
- |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
1250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
3.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
0.011 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss survival |
Moderate |
|
8.6 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
> 0.009 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna growth |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.0025 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Scenedesmus subspicatus |
High |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
2000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
- |
|
> 5.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
Not oxidising or explosive IMDG Transport Hazard Class 9 Not expected to autoignite; Not highly flammable |
|
Health: H373 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
butafenacil |
|
- |
|
- |
|
- |
|
- |
|
butafenacilo |
|
- |
|
butafenacyl |
|
- |
|
- |
|
- |
|
- |