Butachlor (Ref: CP 53619) |
(Also known as: amichlor; CP 53619; rasayanchlor) |
Butachlor is a herbicide used for pre-emergence control of annual grasses and some broad-leaved weeds. It has a low aqueous solubility and a low volatility. Depending on local conditions it may be moderately persistent in some soils. It is not expected to leach to grpundwater. It is moderately toxic to most fauna and flora, the main exception being honeybeesfor which butachlor has a low toxicity. It has a moderate oral mammalian toxicity if ingested and is both a skin and eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Earthworms acute ecotoxicity: High
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen
 Warning: Significant data are missing |
|
A herbicide used for pre-emergence control of annual grasses and some broad-leaved weeds particularly in rice crops |
|
Barnyardgrass; Crab grass; Torpedo grass; Witchgrass; Red deadnettle |
|
Rice; Wheat; Barley; Peanuts |
|
- |
|
- |
|
circa 1970 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₇H₂₆ClNO₂ |
|
CCCCOCN(C1=C(C=CC=C1CC)CC)C(=O)CCl |
|
No data |
|
HKPHPIREJKHECO-UHFFFAOYSA-N |
|
InChI=1S/C17H26ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h8-10H,4-7,11-13H2,1-3H3 |
|
Yes |
|
Herbicide |
|
Chloroacetanilide herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic absorbed primarily via germinating shoots. Inhibition of VLCFA (inhibition of cell division) |
|
23184-66-9 |
|
245-477-8 |
|
354 |
|
112301 |
|
31677 |
|
No data found |
|
311.9 |
|
N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
|
N-butoxymethyl-2-chloro-2',6'-diethylacetanilide |
|
N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
|
PAN Bad Actor Chemical |
|
- |
|
K3 |
|
15 |
|
Not applicable |
|
Not applicable |
|
- |
|
Amber or light yellow oily liquid |
|
|
|
- Monsanto
- FCC
- King Tech Corp
- Makhteshim-Agan
- Pillar International
- BOC Sciences
|
|
- Machete
- Weedout
- Butanox
- Vendaval
|
|
Usually supplied as an emulsifiable concentrate or as granules. |
|
|
|
|
|
20 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
- |
- |
- |
|
-2.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
156 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
165 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
3.16 X 1004 |
Calculated |
- |
|
4.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.073 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
- |
|
0.24 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
3.74 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
56 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
11.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature states DT₅₀ 4 days to 18 days (R4) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
700 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.23 |
Calculated |
Low leachability |
|
|
1.91 X 10-02 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
2.4 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data (Other literature Log BCF range -1.5-0.8 (R3)) |
Low potential |
|
1.7 |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 4640 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
0.515 |
R4 R = Peer reviewed scientific publications 4 = Verified data Eisenia foetida |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.44 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
0.025 |
Danio rerio 30 day |
Moderate |
|
> 2.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
> 0.19 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.2 |
Scenedesmus quadricauda |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
13000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
3.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Occupational exposure may occur through dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
USEPA - possible human carcinogen |
|
|
|
Not expected to autoignite; Not highly flammable |
|
Health: H302, H317, H330 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
Limited shelf-life |
|
|
|
butachlor |
|
butachlore |
|
Butachlor |
|
butachlor |
|
butaclor |
|
butaclor |
|
- |
|
butachlor |
|
- |
|
- |
|
butachloor |
|
- |