Bromophos |
(Also known as: bromofos; ENT 27162) |
Bromophios is an obsolete organophosphate insecticide. It ha a low aqueous solubility and is quite volatile. It is not generally persistent in soil systems but has the potential to leach to groundwater. It is highly toxic to honeybees and aquatic invertebrates but slightly less so to most other species. Bromophos is moderately toxic to mammals if ingested. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor
 |
|
An obsolete organophosphate, broad-spectrum insecticide and acaricide to control biting and sucking pests usually used as the ethyl variant |
|
Granary weevil; Mirids; Aphids; Sawflies; Fruit flies; Beetles; Whiteflies; Cabbage root fly; Beet leaf miner; Onion fly. |
|
Stored wheat grain; Maize; Rice; Cotton; Fruit; Forestry |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1973 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₈H₈BrCl₂O₃PS |
|
COP(=S)(OC)OC1=CC(=C(C=C1Cl)Br)Cl |
|
No data |
|
NYQDCVLCJXRDSK-UHFFFAOYSA-N |
|
InChI=1S/C8H8BrCl2O3PS/c1-12-15(16,13-2)14-8-4-6(10)5(9)3-7(8)11/h3-4H,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
bromophos |
- |
 |
|
Insecticide |
|
Organophosphate insecticide; Organothiophosphate insecticide; Organophosphate acaricide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Broad-spectrum, non-systemic with contact and stomach action |
|
2104-96-3 |
|
218-277-3 |
|
5 |
|
008706 |
|
16422 |
|
015-108-00-3 |
|
366.00 |
|
O-(4-bromo-2,5-dichlorophenyl) O,O-dimethyl phosphorothioate |
|
O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
|
O-(4-bromo-2,5-dichlorophenyl) O,O-dimethyl phosphorothioate |
|
OSPAR soc; PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Aedes caspius, Culex pipiens pipiens, Meligethes aeneus, Anopheles multicolor, Lucilla sericata, plus others |
|
Yellowish crystals |
|
|
|
|
|
|
|
|
|
Available in a variety of formulations including emulsifiable concentrates, wettable powders, dusts, fogs and granules. |
|
|
|
|
|
40 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low |
|
- |
- |
- |
|
53 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.62 X 1005 |
Calculated |
- |
|
5.21 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
17.07 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Highly volatile |
|
2.08 X 1001 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
22 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
1.4 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Clover leaves, n=1 |
|
|
0.35 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Tomato leaves, n=1 |
|
|
12 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately fast |
|
- |
|
|
Stable |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Mobile |
|
17 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.72 |
Calculated |
High leachability |
|
|
5.06 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
4.47 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
1600 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 200 |
K2 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 2 = Unverified data of unknown source Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 85 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 0.44 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
- |
- |
- |
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.18 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Moderate |
|
- |
- |
- |
|
> 0.0086 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.23 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
1600 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.04 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Since bromophos is no longer used as an insecticide in developed world exposure of the general population is expected to be low |
|
May be absorbed through intact skin as well as by the respiratory and gastrointestinal tracts |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Slightly toxic |
|
|
|
Incompatible with sulphur containing substances and organometallic compounds |
|
Health: H302 Environment: H400, H410 |
|
Not classified: Obsolete |
|
- |
|
- |
|
- |
|
|
|
bromophos |
|
bromophos |
|
Bromophos |
|
bromphos |
|
bromofos |
|
bromofos |
|
- |
|
bromofos |
|
- |
|
- |
|
bromofos |
|
- |