Bispyribac |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
Human health Low alert
 |
|
A post-emergence herbicide, usually used as the sodium salt, for the control of grasses, sedges and broad-leaved weeds in paddy rice and other crops/situations |
|
Alligatorweed, Duckweed, Mosquito ferm, Water fern, Water hyacinth, Water pennywort, Parrot feather; Annual bluegrass; Creeping bent grass |
|
Aquatic sitiuations such as drainage ditches, lakes, marshes; Golf courses, turf grass & sod farms |
|
- |
|
Current |
|
1998, discovered; 1997, first introduced |
|
Approved |
|
31/07/2026 |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Italy/Portugal |
|
Not applicable |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₉H₁₈N₄O₈ |
|
COC1=CC(=NC(=N1)OC2=C(C(=CC=C2)OC3=NC(=CC(=N3)OC)OC)C(=O)O)OC |
|
- |
|
RYVIXQCRCQLFCM-UHFFFAOYSA-N |
|
InChI=1S/C19H18N4O8/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4/h5-9H,1-4H3,(H,24,25) |
|
Yes |
|
Herbicide |
|
Pyrimidinyl carboxy compound; Benzoic acid herbicide |
|
- |
|
EU dossier - none identified |
|
Synthetic |
|
Selective, systemic action absorbed by foliage and roots.Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. |
|
125401-75-4 |
|
603-065-9 |
|
748 |
|
- |
|
443031 |
|
No data found |
|
430.37 |
|
2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoic acid |
|
2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoic acid |
|
2,6-bis[(4,6-dimethoxy-2-pyrimidinyl)oxy]benzoic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
Resistance to ALS-inhibitors is locally present in sub-populations of Alisma plantago-aquatica and Schoenoplectus mucronatus in Southern European rice growing areas |
|
- |
|
|
|
|
|
|
|
- Adora 400 SC
- Nominee 400 SC
- Tradewind
|
|
Usually supplied as a suspension concentrate that is mixed with water and applied as a spray |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
|
|
|
|
Major fraction |
- |
- |
|
Major fraction |
- |
- |
|
Minor fraction |
- |
- |
Known groundwater metabolites |
|
|
|
|
|
|
Relevancy unknown |
- |
- |
|
Relevancy unknown |
- |
- |
|
Relevancy unknown |
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.01 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
0.072 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Risks acceptable for proposed uses |
|
Risks acceptable for proposed uses |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
Not explosive Not expected to autoignite; Not highly flammable |
|
Health: H317, H319 Environment: H411 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
bispyribac |
|
bispyribac |
|
Bispyribac |
|
bispyribac |
|
bispyribac |
|
bispiribac |
|
- |
|
bispirybak |
|
- |
|
- |
|
- |
|
- |