Bentazone-sodium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
Human health Low alert
 |
|
A post-emergence contact diazinone herbicide used to control annual weeds in a variety of crops |
|
Black bindweed; Nightshade; Fat hen; Hedge mustard; Shepherd's purse; Wild radish; Wild turnip; Bellvine; Starburr; Anoda weed |
|
Corn; Rice; Alfalfa; Sorghum; Linseed; Peanuts; Beans; Peas; Clover; Chives; Garlic; Ornamentals e.g. begonia; Soybeans; Turf |
|
- |
|
Current |
|
1972, first introduced |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Netherlands/Germany |
|
31/05/2025 |
|
No |
|
Yes - as acid |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
None |
|
C₁₀H₁₂N₂NaO₃S |
|
CC(C)N1C(=O)C2=CC=CC=C2[N-]S1(=O)=O.[Na+] |
|
- |
|
NCLRGQCNIDLTDW-UHFFFAOYSA-M |
|
InChI=1S/C10H12N2O3S.Na/c1-7(2)12-10(13)8-5-3-4-6-9(8)11-16(12,14)15;/h3-7H,1-2H3,(H,11,13);/q;+1/p-1 |
|
Yes |
|
Herbicide |
|
Benzothiazinone herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective action, absorbed by foliage with very little translocation. Inhibits photosynthesis (photosystem II). |
|
50723-80-3 |
|
256-735-4 |
|
366 |
|
- |
|
13124860 |
|
613-012-00-1 |
|
263.27 |
|
sodium 2,2,4-trioxo-3-(propan-2-yl)-3,4-dihydro-2λ6,1,3-benzothiadiazin-1-ide |
|
sodium 3,4-dihydro-3-isopropyl-4-oxo-2,1,3-benzothiadiazin-1-ide 2,2-dioxide |
|
3-(1-methylethyl)-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide sodium salt |
|
Potential groundwater contaminant |
|
UK Environment Agency statutory standard for the protection of surface water quality and aquatic life: annual mean classification of inland waters, coastal waters & relevant territorial waters: 500 µg l⁻¹ |
|
C3 |
|
6 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- |
|
Usually formulated as a soluble concentrate or granules, mixed with water and applied as a spray |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
Insoluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
|
|
|
|
Minor fraction |
- |
- |
|
Major fraction |
- |
- |
|
Minor fraction |
- |
- |
Known groundwater metabolites |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.09 |
as bentazone |
- |
|
1.0 |
as bentazone |
- |
|
- |
- |
- |
|
0.13 |
as bentazone |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
Minimal risk of dietary exposure No unacceptable risks to bystanders identified |
|
Risk of exposure acceptable under label recommendations for use for personal protection clothing and equipment |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Almost entirely excreted in the urine. |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
|
|
|
Possible blood, liver, kidney toxicant |
|
|
|
Not oxidising or explosive Not expected to autoignite IMDG Transport Hazard Class 6.1 |
|
Health: H302, H317, H319 Environment: H412 |
|
II (Moderately hazardous) |
|
UN13077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
bentazone-sodium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |