Bensulide (Ref: R 4461) |
(Also known as: benzulfide) |
Bensulide is an organophosphate herbicide. It has a low aqueous solubility, miscible with most common organic solvents and shows a low to moderate volatility. It may persist in soil and water systems under certain conditions. They is a low risk of leaching to groundwater. Bensulide has a moderate toxicity to humans as well as being a cholinesterase inhibitor and a neurotoxin. It is moderately toxic to birds, fish, aquatic plants and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Daphnia chronic ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
A selective, pre-emergence organophosphorus herbicide |
|
Bluegrass; Crabgrass; Pigweed; Red deadnettle; Goosegrass; Lambsquarters; Shepherd's purse; Fescue; Bentgrass |
|
Carrots; Cucumbers; Melon; Peppers; Lettuce; Brassicas; Squash; Tomatoes; Cotton; Turf |
|
- |
|
Current |
|
1962 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₄H₂₄NO₄PS₃ |
|
CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)C1=CC=CC=C1 |
|
No data |
|
RRNIZKPFKNDSRS-UHFFFAOYSA-N |
|
InChI=1S/C14H24NO4PS3/c1-12(2)18-20(21,19-13(3)4)22-11-10-15-23(16,17)14-8-6-5-7-9-14/h5-9,12-13,15H,10-11H2,1-4H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
bensulide |
- |
 |
|
Herbicide |
|
Organophosphate herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, acts by inhibiting germination, absorbed through leaves and roots |
|
741-58-2 |
|
212-010-4 |
|
295 |
|
009801 |
|
12932 |
|
015-083-00-9 |
|
397.51 |
|
S-[2-(benzenesulfonamido)ethyl] O,O-di(propan-2-yl) phosphorodithioate |
|
O,O-diisopropyl S-2-phenylsulfonylaminoethyl phosphorodithioate |
|
O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] phosphorodithioate |
|
Potential groundwater contaminant; PAN Bad Actor Chemical |
|
- |
|
N |
|
8 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless to yellow viscous liquid |
|
|
|
- Scotts Co
- Gowan Co
- PBI
- Stauffer
|
|
- Exporsan
- Betasan
- Pre-San
- Betamec
- Prefar
- Agway Betasan
- Acme Stopit Crabgrass Preventer
|
|
Usually supplied as an emulsifiable concentrate or as granules. |
|
|
|
|
|
25 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Ethanol |
- |
Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Xylene |
- |
|
34.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
- |
|
100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
157 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
- |
|
|
1.58 X 1004 |
Calculated |
- |
|
4.2 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Not applicable |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
- |
No dissociation |
|
0.133 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
2.11 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
90 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
120 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data. May persist for up to a year |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent |
|
Not pH sensitive |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
3900 |
|
Best available data |
|
|
43.1 |
|
Slightly mobile |
|
1448 |
|
1.04 |
|
Kf range 11.0-65.4 mL g⁻¹, Kfoc range 785-2037 mL g⁻¹, 1/n - no data, Soils=3 |
|
- |
|
|
|
|
|
1.74 |
Calculated |
Low leachability |
|
|
5.79 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
880 |
Whole fish |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
270 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
1 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
- |
- |
|
- |
- |
- |
|
> 1386 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
24.0 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
> 1.6 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 1.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
> 0.58 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
< 0.0042 |
Daphnia magna |
High |
|
0.051 |
Americamysis bahia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.11 |
Lemna gibba |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
270 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
1.75 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Moderately toxic May cause convulsions at high doses May cause respiratory problems |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H302 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN3018 |
|
- |
|
- |
|
|
|
bensulide |
|
bensulide |
|
Bensulid |
|
bensulid |
|
bensulide |
|
bensulida |
|
- |
|
bensulid |
|
- |
|
- |
|
bensulide |
|
- |