Bensulfuron (Ref: IN R9419) |
(Also known as: free acid bensulfuron-methyl) |
Bensulfuron is a herbicide normally used as the methyl variant. It is not expected to be persistent in soil and as it is considered moderately mobile there are some risks of leaching to groundwater. Based on bensulfurons physico-chemical properties there may also be a risk of bio-concentration. Its is moderately toxic to aquatic plants and to earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
A pyrimidinylsulfonylurea herbicide used to control annual and perennial weeds and sedges. Usually used as the methyl variant. Pesticide transformation product. |
|
Pigweed; Chickweed; Wild mustard; Stinkgrass; Barnyardgrass; Rice flatsedge; Dwarf umbrella grass; Nut-grass; Creeping water primrose |
|
Cereals especially wheat; Rice |
|
- |
|
Current |
|
1985 |
|
Approved |
|
31/10/2025 |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Italy/Spain |
|
31/10/2023 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
|
✓ |
✓ |
|
|
|
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
✓ |
✓ |
✓ |
|
✓ |
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
|
|
|
|
|
None |
|
C₁₅H₁₆N₄O₇S |
|
COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)CC2=CC=CC=C2C(=O)O)OC |
|
No data |
|
PPWBRCCBKOWDNB-UHFFFAOYSA-N |
|
InChI=1S/C15H16N4O7S/c1-25-11-7-12(26-2)17-14(16-11)18-15(22)19-27(23,24)8-9-5-3-4-6-10(9)13(20)21/h3-7H,8H2,1-2H3,(H,20,21)(H2,16,17,18,19,22) |
|
Yes |
|
Herbicide, Metabolite |
|
Soil, Surface water, Sediment, Groundwater |
|
Sulfonylurea herbicide; Pyrimidinylsulfonylurea herbicide |
|
- |
|
EU dossier - None declared |
|
Synthetic |
|
Selective, systemic action being absorbed through foliage and roots. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
99283-01-9 |
|
874-914-0 |
|
502 |
|
Not listed |
|
107828 |
|
607-178-00-4 |
|
396.38 |
|
2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}methyl)benzoic acid |
|
α-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-o-toluic acid |
|
2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]benzoic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- |
|
Usually formulated as the methyl variant |
|
|
|
|
|
67 |
as methyl variant |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.17 X 1000 |
Calculated |
- |
|
0.79 |
as methyl variant |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.52 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
4.99 X 10-03 |
as methyl variant |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegrdable |
|
|
27.8 |
|
Non-persistent |
|
27.8 |
|
Non-persistent |
|
- |
- |
- |
|
129.3 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
EU 2022 dossier lab studies DT₅₀ (normalised) range 21.4-74.6 days, DT₉₀ (measured) range 26.8-277 days, Soils=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
5.2 |
|
Fast |
|
8.0 |
|
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
8.8 |
|
Moderately mobile |
|
226 |
|
0.9 |
|
EU dossier Kf range 0.3-17.4 mL g⁻¹, Kfoc range 28-580 mL g⁻¹, 1/n range 0.89-0.93, Soils=5 |
|
No |
|
|
|
|
|
2.38 |
Calculated |
Transition state |
|
|
1.16 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
|
|
|
|
|
Major fraction |
0.182 |
- |
|
Major fraction |
0.460 |
- |
|
Minor fraction |
0.043 |
- |
|
Major fraction |
0.210 |
- |
Known groundwater metabolites |
|
|
|
|
|
|
Relevancy unknown |
- |
- |
|
Relevancy unknown |
- |
- |
|
Relevancy unknown |
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat as methyl variant |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2510 |
Anas platyrhynchos as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida |
Low |
|
230 |
Eisenia andrei as mg ha⁻¹ |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
Apis mellifera as methyl variant |
Low |
|
> 51.4 |
Apis mellifera as methyl variant |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 600 |
Aphidius rhopalosiphi as methyl variant |
- |
|
> 600 |
Typhlodromus pyri adults as methyl variant |
- |
|
- |
- |
- |
|
|
|
|
|
> 66 |
Oncorhynchus mykiss as methyl variant |
Moderate |
|
- |
- |
- |
|
130 |
Daphnia magna as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
6.2 |
Lemna gibba |
Moderate |
|
26.4 |
Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat as methyl variant |
Low |
|
2000 |
Rat as methyl variant |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.2 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
0.12 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to autoignite; Not higghly flammable |
|
- |
|
U (Unlikely to present an acute hazard) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
bensulfuron |
|
bensulfuron |
|
Bensulfuron |
|
bensulfuron |
|
bensulfuron |
|
bensulfuron |
|
- |
|
bensulfuron |
|
- |
|
benszulforon |
|
- |
|
- |