Bendiocarb (Ref: NC 6897) |
(Also known as: bendiocarbe; bencarbate) |
Bendiocarb is a carbamate insecticide and veterinary treatment. It has a moderate aqueous solubility, moderate volatility, is moderately mobile but, based on its chemical properties, would not be expected to leach to groundwater. It is highly toxic to mammals but tends not to bioaccumulate. It has a moderate to high toxicity for most aquatic organisms. It is highly toxic to birds and honey so but slightly less to earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute contact ecotoxicity: High; Bees acute oral ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Endocrine distrupter; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
A carbamate insecticide with a wide range of uses including storage, soil-dwelling and some foliar pests. Also has some veterinary applications. |
|
Beetles; Aphids; Mites; caterpillars; Spiders; Wasps; Ants; Flies |
|
Non-cropped areas including paths, railroads; Residences and commercial buildings; Turf; Ornamentals |
|
- |
|
Current |
|
1971 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₁₃NO₄ |
|
CC1(OC2=C(O1)C(=CC=C2)OC(=O)NC)C |
|
- |
|
XEGGRYVFLWGFHI-UHFFFAOYSA-N |
|
InChI=1S/C11H13NO4/c1-11(2)15-8-6-4-5-7(9(8)16-11)14-10(13)12-3/h4-6H,1-3H3,(H,12,13) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
bendiocarb |
- |
 |
|
Insecticide, Veterinary substance |
|
Carbamate insecticide |
|
- |
|
- |
|
Synthetic |
|
Systemic, with contact and stomach action resulting in rapid knock-down. Acetylcholinesterase (AChE) inhibitor. |
|
22781-23-3 |
|
245-216-8 |
|
232 |
|
105201 |
|
2314 |
|
006-046-00-8 |
|
223.23 |
|
2,2-dimethyl-2H-1,3-benzodioxol-4-yl methylcarbamate |
|
2,2-dimethyl-1,3-benzodioxol-4-yl methylcarbamate |
|
2,2-dimethyl-1,3-benzodioxol-4-yl methylcarbamate |
|
Marine Pollutant; PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
Anopheles albimanus, Aonidella aurantii, Culex pipiens pipiens, plus others |
|
White odoureless crystals |
|
|
|
- Farnham Co
- Bayer Environmental Science
- FBC
- NOR-AM
|
|
- Multimet
- Sudoxin
- Tattoo
- Seedox
- Ficam
- Turcam Plus
- Garvox
- 891 Wasp & Hornet Killer
|
|
Usually supplied in formulations for topical administration including impregnated collars |
|
|
|
|
|
280 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data |
Moderate |
|
250 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Dichlorobenzene |
- |
175000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
40000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
225 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
|
126.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.01 X 1001 |
Calculated |
- |
|
1.7 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.29 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
- |
|
8.8 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Very weak acid |
|
4.6 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low volatility |
|
4.00 X 10-03 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
3.5 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
5.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
3.5 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature values vary from a few days to a few weeks depending on soil type |
|
|
18.3 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Azelea leaves, undercover, n=1 |
|
|
4.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 3.6-8.0 days, 5 field crops, various matrices, n=10 |
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
- |
|
|
25 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
Hydrolysed rapidly in alkali media, slows under acid and neutral conditions |
|
2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
385 |
|
Other sources Koc 570 mL g⁻¹ (DW3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.77 |
Calculated |
Low leachability |
|
|
2.19 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
64.8 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Lepomis macrochirus |
Low potential |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
34 |
B3 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 3 = Unverified data of known source Rat |
High |
|
|
0.75 |
B3 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 3 = Unverified data of known source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
> 3.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
188 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
0.43 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Apis mellifera |
High |
|
0.52 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Apis mellifera |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 1.55 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
0.03 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
0.00074 |
Daphnia magna |
High |
|
0.006 |
Americamysis bahia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1.71 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Moderate |
|
0.32 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
34 |
B3 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 3 = Unverified data of known source Rat |
High |
|
566 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.55 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
0.004 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
The compound was rapidly and extensively absorbed and completely metabolised following oral administration. |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
May cause hepatic and renal diseases May cause respiratory problems Endocrine issues - Weak estrogen effect |
|
|
|
Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6,1 |
|
Health: H301, H331, H312 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2757 |
|
- |
|
- |
|
|
|
bendiocarb |
|
bendiocarbe |
|
Bendiocarb |
|
bendiocarb |
|
bendiocarb |
|
bendiocarb |
|
bendiocarb |
|
bendiokarb |
|
- |
|
- |
|
bendiocarb |
|
- |