Aramite (Ref: ENT 16519) |
(Also known as: aratron; niagaramite; compound 88R ; 88-R) |
Aramite is an obsolete miticide and antimicrobial agent. It has a low aqueous solubility and a low volatility. It may be persistent in soil systems depending upon local conditions. Aramite is not expected to leach to groundwater based on its physico-chemical properties. It is moderately toxic to fish. highly toxic to aquatic invertebrates. It has a low oral mammalian toxicity but may be carcinogenic. It is a recognised irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health High alert: Carcinogen
 Warning: Significant data are missing |
|
An obsolete plant miticide and antimicrobial agent |
|
Mites including the European red mite, Pacific spider mite, Strawberry spidermite, Two-spotted spidermite |
|
Fruit; Vegetables; Ornamentals |
|
- |
|
Considered obsolete but may be available in some countries |
|
1954 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Aramite is a chiral molecule. The technical material is an isomeric mixture. |
|
C₁₅H₂₃ClO₄S |
|
CC(COC1=CC=C(C=C1)C(C)(C)C)OS(=O)OCCCl |
|
No data |
|
YKFRAOGHWKADFJ-UHFFFAOYSA-N |
|
InChI=1S/C15H23ClO4S/c1-12(20-21(17)19-10-9-16)11-18-14-7-5-13(6-8-14)15(2,3)4/h5-8,12H,9-11H2,1-4H3 |
|
Yes |
|
Insecticide, Miticide, Acaricide |
|
Sulphite ester insecticide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic with contact action, inhibits oxidative phosphorylation |
|
140-57-8 |
|
690-073-0 |
|
None allocated |
|
062501 |
|
8809 |
|
No data found |
|
334.87 |
|
rac-(2R)-1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite |
|
(RS)-2-(4-tert-butylphenoxy)-1-methylethyl 2-chloroethyl sulfite |
|
2-(4-tert-butylphenoxy)-l-methylethyl 2-chloroethyl sulphite |
|
PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
2B |
|
Not applicable |
|
- |
|
Colourless liquid |
|
|
|
|
|
- Ortho-mite
- Niagaramite
- Aramite
|
|
No longer available but was originally supplied as a wettable powder |
|
|
|
|
|
0.59 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
100000 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Ethanol |
- |
100000 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Benzene |
- |
100000 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Acetone |
- |
100000 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Ether |
- |
|
-37.3 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.61 X 1004 |
Calculated |
- |
|
4.82 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.143 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.029 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low volatility |
|
0.193 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
150 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
5.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Alfalfa leaves, n=1 |
|
|
4.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.0-9.0 days, various matrices from 3 field grown crops, n=4 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
V1 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 1 = Estimated data with little or no verification |
Slightly mobile |
|
2000 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.52 |
Calculated |
Low leachability |
|
|
4.26 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
2265 |
|
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
3900 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
5000 |
Coturnix japonica |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.32 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
0.069 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
3900 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Public and consumer exposure should be very low since aramite has been discontinued and currently has little commercial interest. |
|
Occupational exposure should be very low since aramite has been discontinued and currently has little commercial interest. |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Gastrointestinal and liver toxicant IARC Group 2b carcinogen |
|
|
|
No information available |
|
Not classified: Obsolete |
|
Not classified: Obsolete |
|
- |
|
- |
|
- |
|
|
|
aramite |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |