Aminocyclopyrachlor (Ref: DPX-MAT28) |
(Also known as: KJM44) |
Aminocyclopyrachlor is a herbicide that is approved for use in most of the developed world. It is highly soluble in water. has a low volatility and is moderately persistent in soil systems. Persistent in aquatic systems will depend on local conditions. Based on its chemical properties there is a risk this chemical could leach to groundwater. It is not highly toxic to humans and tends to generally have a low to moderate toxicity to biodiversity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
An unclassified herbicide for the control of woody weeds |
|
Woody weeds; Vines; Brambles |
|
Sod farms; Turf lawns; Recreational areas; Sports fields including golf courses |
|
- |
|
Current |
|
2008 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₈H₈ClN₃O₂ |
|
C1CC1C2=NC(=C(C(=N2)N)Cl)C(=O)O |
|
No data |
|
KWAIHLIXESXTJL-UHFFFAOYSA-N |
|
InChI=1S/C8H8ClN3O2/c9-4-5(8(13)14)11-7(3-1-2-3)12-6(4)10/h3H,1-2H2,(H,13,14)(H2,10,11,12) |
|
Yes |
|
Herbicide |
|
Soil |
|
Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
Synthetic auxin readily absorbed by plant leaves and roots. Translocates in both the xylem and phloem and is thought to accumulate in the meristematic areas of the plant. |
|
858956-08-8 |
|
617-769-9 |
|
None allocated |
|
288008 |
|
17747875 |
|
No data found |
|
213.62 |
|
6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid |
|
6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid |
|
6-amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid |
|
PAN listed Highly Hazardous Chemical; Highly toxic to spruce and pine trees |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
None identified |
|
White solid with a fruit odour |
|
|
|
|
|
|
|
3130 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
High |
|
- |
- |
- |
|
140.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.31 X 10-03 |
Calculated |
- |
|
-2.48 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.47 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
4.6 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
- |
|
6.92 X 10-03 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
3.47 X 10-12 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
31 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature data bare soil DT₅₀ 31days, turf DT₅₀ range 10.8-21 days; Manuufacterer data: DT₅₀ turf 37 to 103 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
1.2 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderately fast |
|
- |
|
|
- |
- |
- |
|
- |
|
365 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Stable |
|
450 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Stable |
Soil adsorption and mobility |
|
|
|
|
|
|
|
0.39 |
- |
Mobile |
|
24.0 |
|
Manufacturers data Kd range 0.03-2.05, Koc range 2.0-55 mL g⁻¹, soils=20 |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.91 |
Calculated |
High leachability |
|
|
7.94 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
3.162 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
- |
- |
None
Known groundwater metabolites |
|
|
|
|
|
|
cyclopropanecarboxylic acid |
- |
Surface water (aqueous photolysis) |
- |
- |
(3-[5-cyclopropyl-I ,2,4-oxadiazol-3yl]-5-[ I -methylethyl]-imidazo ( 1,5-a )-19 quinoxalin-4[5H]-one) |
panadiplon |
Animals |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5290 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
367 |
E4 E = Manufacturers safety data sheets 4 = Verified data Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
|
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 120 |
Lepomis macrochirus |
Low |
|
11.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss 90 day |
Low |
|
> 27.2 |
Daphnia magna |
Moderate |
|
< 0.37 |
Daphnia magna |
Moderate |
|
> 122 |
Americamysis bahia |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 122 |
E4 E = Manufacturers safety data sheets 4 = Verified data Lemna gibba |
Low |
|
> 120 |
Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
> 6.9 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
>85% of dose excreted; <1% of dose in milk and edible tissues |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
- |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
aminocyclopyrachlor |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |