Amidoflumet (Ref: S-1955) |
(Not known by any other names) |
Amidoflumet is a public health insect not approved for use in most of the developed world. Little is know about its chemical properties, environmental fate nor its toxicity to humans or biodiversity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Reproduction/development effects
 Warning: Significant data are missing |
|
A trifluoromethanesulfonanilide amenity insecticide used to control house dust mite and other insect pests. |
|
House dust mite; Cockroaches; Houseflies |
|
Domestic households; Public buildings |
|
- |
|
Current |
|
2004 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₇ClF₃NO₄S |
|
COC(=O)C1=C(C=CC(=C1)Cl)NS(=O)(=O)C(F)(F)F |
|
No data |
|
KBHDSWIXRODKSZ-UHFFFAOYSA-N |
|
InChI=1S/C9H7ClF3NO4S/c1-18-8(15)6-4-5(10)2-3-7(6)14-19(16,17)9(11,12)13/h2-4,14H,1H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
amidoflumet |
- |
 |
|
Insecticide, Acaricide |
|
Trifluoromethanesulfonanilide insecticide; Trifluoromethanesulfonanilide acaricide |
|
- |
|
- |
|
Synthetic |
|
Unknown mechanism, fast action |
|
84466-05-7 |
|
804-574-0 |
|
None allocated |
|
- |
|
9861780 |
|
No data found |
|
317.66 |
|
methyl 5-chloro-2-(1,1,1-trifluoromethanesulfonamido)benzoate |
|
methyl 5-chloro-2-(((trifluoromethyl)sulfonyl)amino)benzoate |
|
methyl 5-chloro-2-(((trifluoromethyl)sulfonyl)amino)benzoate |
|
Marine pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
Slightly yellow or colorless crystalline solid |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
81 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.35 X 1002 |
Calculated |
- |
|
2.13 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source at pH 5 24 °C |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
3.8 |
- |
- |
- |
|
0.000051 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
200 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
6.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Cyprinus carpio 48 hr |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
200 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Moderate |
|
2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
5.44 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Exposure may cause decreases in spontaneous activity, ataxic gait and irregular respiration Possible liver toxicant |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H301 Environment: H411 |
|
- |
|
- |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
amidoflumet |
|
amidoflumet |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |