Alpha-hexachlorocyclohexane (Ref: ENT 9232) |
(Also known as: alpha-HCH; alpha-benzenehexachloride; alpha-BHC; alpha-lindane) |
Alpha-hexachlorocyclohexane is an insecticide that is not generally approved for use in the developed world. It is moderately toxic to mammals and considered to be carcinogenic. Alpha-hexachlorocyclohexane has a low aqueous solubility and is highly volatile. It is moderately persistent is soil and slightly mobile. It is moderately toxic to birds and aquatic organisims. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Carcinogen
 |
|
Historically an insecticide and a component of the mixed isomer product but now only produced as a byproduct of lindane production. It is also a lindane impurity that has some insecticidal properties |
|
Soil-dwelling and plant eating insects |
|
Fruit and vegetable crops; Forestry; Public health applications |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
There are nine stereoisomers (eight diastereomers, one of which has two enantiomers). |
|
C₆H₆Cl₆ |
|
- |
|
No data |
|
JLYXXMFPNIAWKQ-LKPKBOIGSA-N |
|
InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4-,5+,6+/m0/s1 |
|
Yes |
|
Insecticide, Other substance |
|
Impurity |
|
Organochloride insecticide |
|
- |
|
- |
|
Synthetic |
|
Not applicable |
|
319-84-6 |
|
206-270-8 |
|
None allocated |
|
- |
|
727 |
|
No data found |
|
290.83 |
|
- |
|
- |
|
α-hexachlorocyclohexane |
|
POP; Water pollutant; Marine pollutant; PAN Bad Actor Chemical; Chemical subject to PIC regulations; Possible groundwater pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
2A |
|
Not applicable |
|
- |
|
White to beige coloured crystalline powder |
|
|
|
|
|
|
|
2.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
18000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ether |
- |
|
159 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
288 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.61 X 1003 |
Calculated |
- |
|
3.82 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High |
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
1.87 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
5.99 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderately volatile |
|
- |
- |
- |
|
No absorption > 290nm |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
175 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
DT₅₀ sandy loam 55 days in subtropical conditions (R2), temperate climate data suggests 150-200 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
Not thought to be a major degradation route |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Slightly mobile |
|
1888 |
|
Literature gives Koc range 1780-1995 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.62 |
Calculated |
Low leachability |
|
|
4.93 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
177 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.820 |
Danio rerio |
Moderate |
|
- |
- |
- |
|
0.370 |
Daphnia magna |
Moderate |
|
0.1 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Daphnia magna 25 day EC₅₀ |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 10 |
Chlorella pyrenoidosa |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
177 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I |
- |
- |
|
|
May be absorbed through the skin |
|
May be absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Exposure may cause dyspnoea, anorexia, tremors, convulsions and cramps Liver, kidney and heart toxicant |
|
|
|
Flammable IMDG Transport Hazard Class 6.1 |
|
- |
|
Not listed |
|
UN2811 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
alpha-hexachlorocyclohexane |
|
- |
|
alpha-Hexachlorocyclohexan |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |