Aldoxycarb |
(Also known as: aldicarb sulfone; aldoxycarbe; sulfocarb; ENT AI3 29261 ; UC 21865; aldicarb sulfure) |
Aldoxycarb is an insecticide for the control of sucking and chewing pests. It is highly soluble in water, volatile and, based on its chemical properties, has a tendency to leach to groundwater. It is not persistent in soil systems but may be stable in aquatic systems under certain conditions. Aldoxycarb is toxic to mammals, most aquatic life and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Very mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Earthworms acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
An insecticide and nematicide which is the sulfone analogue of aldicarb, currently used outside the EU to control honey locust and gall midge amongst others. Can also be a pesticide transformation product |
|
Honey locust; Gall midge; Nematodes |
|
Cotton; Potatoes; Sugarbeet; Ornamentals |
|
- |
|
Current |
|
1965 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₇H₁₄N₂O₄S |
|
CC(C)(C=NOC(=O)NC)S(=O)(=O)C |
|
CC(C)(/C=N/OC(=O)NC)S(=O)(=O)C |
|
YRRKLBAKDXSTNC-UHFFFAOYSA-N |
|
InChI=1S/C7H14N2O4S/c1-7(2,14(4,11)12)5-9-13-6(10)8-3/h5H,1-4H3,(H,8,10)/b9-5+ |
|
Yes |
|
Insecticide, Nematicide, Metabolite |
|
Soil |
|
Carbamate insecticide; Carbamate acaricide |
|
- |
|
- |
|
Synthetic |
|
Systemic. Acetylcholinesterase (AChE) inhibitor. |
|
1646-88-4 |
|
216-710-0 |
|
None allocated |
|
110802 |
|
9570093 |
|
No data found |
|
222.26 |
|
(5E)-7,7-dimethyl-8,8-dioxo-4-oxa-8?6-thia-2,5-diazanon-5-en-3-one |
|
(EZ)-2-mesyl-2-methylpropionaldehyde O-methylcarbamoyloxime |
|
2-methyl-2-(methylsulfonyl)propanal O-[(methylamino)carbonyl]oxime |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
- |
|
Crystalline powder with slightly sulphurous odour |
|
|
|
- Bayer CropScience
- Union Carbide Agriculture Products, Co.
- Rhone-Poulenc
|
|
|
|
- |
|
|
|
|
|
10000 |
|
High |
|
- |
- |
- |
|
141 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.69 X 10-01 |
Calculated |
- |
|
-0.57 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.35 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
12 |
|
Highly volatile |
|
2.87 X 10-06 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
21 |
|
Non-persistent |
|
- |
- |
- |
|
20 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Reported DT₅₀ of 2-4 weeks |
|
|
- |
- |
- |
|
- |
|
|
14.9 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Sugarbeet leaves, n=1 |
|
|
Stable |
|
Stable |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Very mobile |
|
10 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.90 |
Calculated |
High leachability |
|
|
5.44 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Very mobile |
Calculated |
- |
|
|
0.07 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
Known groundwater metabolites |
|
None
|
|
|
|
|
aldoxycarb oxime |
- |
Plant; Animal |
- |
- |
aldoxycarb methylol |
- |
Plants |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
27 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
25.4 |
Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.163 |
Allolobophora caliginosa |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 50 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
0.236 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
Oral |
|
|
1.698 |
R4 R = Peer reviewed scientific publications 4 = Verified data Nomia melanderi |
Moderate |
|
Oral |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
35.3 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
0.28 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
27 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
High |
|
1000 |
Rat |
- |
|
0.209 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
Possible |
No data found |
|
|
|
Highly toxic May cause headache, dizziness, weakness, ataxia, diarrhoea, convulsions and death |
|
|
|
Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6,1 |
|
Handling: H225, GHS02, GHS07 Health: H312, H319, H332 |
|
Not classified: Obsolete |
|
UN2757 |
|
- |
|
- |
|
|
|
aldoxycarb |
|
aldoxycarbe |
|
Aldoxycarb |
|
aldoxycarb |
|
aldoxycarb |
|
aldoxicarb |
|
- |
|
aldoksykarb |
|
- |
|
- |
|
- |
|
- |