Acynonapyr (Ref: NA-89) |
(Not known by any other names) |
Acynonapyr is an iinsecticide used to selectively control spider mite. Little has currenlty been published regarding its environmental fate and behaviour. Acynonapyr is toxic to fish. It is not highly toxic to mmmals either via ingestion or in contact with the skin. It is reported to have developmental effects and may be a liver and kidney toxicant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity High alert: Fish acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Reproduction/development effects
 |
|
An insecticide and acaricide that is currently registered in Japan |
|
Spider mites |
|
Vegetables; Tea; Citrus; Cut flowers |
|
- |
|
Novel; Current |
|
2019, registered Japan |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Racemic. The (S)-enantiomer is the most active. |
|
C₂₄H₂₆F₆N₂O₃ |
|
CCCOC1=C(C=CC(=C1)C(F)(F)F)OC2CC3CCCC(C2)N3OC4=NC=C(C=C4)C(F)(F)F |
|
CCCOC1=C(C=CC(=C1)C(F)(F)F)OC2C[C@H]3CCC[C@@H](C2)N3OC4=NC=C(C=C4)C(F)(F)F |
|
GIDAJLLAARKRMS-BWTSREIZSA-N |
|
InChI=1S/C24H26F6N2O3/c1-2-10-33-21-11-15(23(25,26)27)6-8-20(21)34-19-12-17-4-3-5-18(13-19)32(17)35-22-9-7-16(14-31-22)24(28,29)30/h6-9,11,14,17-19H,2-5,10,12-13H2,1H3/t17-,18+,19+ |
|
Yes |
|
Insecticide, Acaricide |
|
Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
Acts on inhibitory glutamate receptors and disrupts neurotransmission. Calcium-activated potassium channel (KCa2) modulator. |
|
1332838-17-1 |
|
696-576-1 |
|
None allocated |
|
- |
|
132115472 |
|
No data found |
|
504.47 |
|
(1R,3r,5S)-3-(2-propoxy-4-(trifluoromethyl)phenoxy)-9-((5-(trifluoromethyl)pyridin-2-yl)oxy)-9-azabicyclo(.3.1)nonane |
|
3-endo-(2-propoxy-4-(trifluoromethyl)phenoxy)-9-((5-(trifluoromethyl)-2-pyridyl)oxy)-9-azabicyclo(3.3.1)nonane |
|
(3-endo)-3-(2-propoxy-4-(trifluoromethyl)phenoxy)-9-((5-(trifluoromethyl)-2-pyridinyl)oxy)-9-azabicyclo(3.3.1)nonane |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
33 |
|
Not applicable |
|
- |
|
Pale yellow solid with slight aromatic odour |
|
|
|
|
|
|
|
Usually formulated as an emulsifiable concentrate |
|
|
|
|
|
0.004 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source at 30 °C |
Low |
|
- |
- |
- |
|
77.2 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
Degrades before boiling |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
165 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
|
|
4.47 X 1006 |
Calculated |
- |
|
6.65 |
E4 E = Manufacturers safety data sheets 4 = Verified data at 25 °C |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
- |
|
8.3 X 10-08 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.021 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible liver, lung and lymph node toxicant Body weight suppressant |
|
|
|
No information available |
|
Environment: H400 |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
acynonapyr |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |