2,4-D-dimethylammonium |
(Also known as: 2,4-D dimethyl amine salt) |
2,4-D-dimethylammonium is selective phenoxy herbicide and plant growth regulator. Data related specifically to the dimethylammonium variant is limited but a fuller dataset is available as 2,4-D. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Birds chronic ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate; Earthworms chronic ecotoxicity: Moderate
 |
Human health High alert: Reproduction/development effects
 |
|
A translocated phenoxy herbicide for use in cereals, grass and amenity use. |
|
Broad-leaved weeds, Evasive weeds in aquatic situations |
|
Turf grass & pastures; Non-cropping situations; Amenity sites; Almonds; Orchards; Cereals including barley, wheat and oats; Lucerne |
|
- |
|
Current |
|
cira 1950 |
|
Approved |
|
31/12/2030 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Greece/Poland |
|
31/12/2030 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
None |
|
C₁₀H₁₃Cl₂NO₃ |
|
CNC.C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |
|
- |
|
IUQJDHJVPLLKFL-UHFFFAOYSA-N |
|
InChI=1S/C8H6Cl2O3.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-3-2/h1-3H,4H2,(H,11,12);3H,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
2,4-dichlorophenoxy)acetic acid |
Derivative |
 |
|
Herbicide, Plant Growth Regulator |
|
Phenoxy herbicide; Phenoxy PGR; Auxin PGR |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, absorbed through roots and increases biosynthesis and production of ethylene causing uncontrolled cell division and so damages vascular tissue. Synthetic auxin. |
|
2008-39-1 |
|
217-915-8 |
|
1 |
|
030019 |
|
16180 |
|
No data found |
|
266.12 |
|
(2,4-dichlorophenoxy)acetic acid—N-methylmethanamine (1/1) |
|
dimethylammonium (2,4-dichlorophenoxy)acetate |
|
2-(2,4-dichlorophenoxy)acetic acid compound with N-methylmethanamine (1:1) |
|
- |
|
UK statutory standard for protection of aquatic life for inland, coastal & territorial surface waters: 1.0 µg l⁻¹ as annual mean conc |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
24300 |
as 2,4-D |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.51 X 10-01 |
Calculated |
- |
|
-0.82 |
as 2,4-D |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
0.009 |
as 2,4-D |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readiliy biodegradable |
|
|
4.4 |
as 2,4-D |
Non-persistent |
|
4.4 |
as 2,4-D |
Non-persistent |
|
28.8 |
as 2,4-D |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
EU dossier data for 2,4-D |
|
|
- |
- |
- |
|
- |
|
|
1.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Wheat straw, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
0.7 |
as 2,4-D |
Mobile |
|
39.3 |
|
EU dossier data for 2,4-D |
|
|
0.45 |
as 2,4-D |
Mobile |
|
24 |
|
0.83 |
|
EU dossier data for 2,4-D |
|
No |
|
|
|
|
|
3.82 |
Calculated |
High leachability |
|
|
6.92 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 639 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5620 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
> 100 |
Colinus virginianus as 2,4-D |
Moderate |
|
350 |
Eisenia foetida as 2,4-D |
Moderate |
|
62.5 |
Eisenia foetida as 2,4-D |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
Apis mellifera as 2,4-D |
Low |
|
94 |
Apis mellifera as 2,4-D |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 495 |
Pimephales promelas |
Low |
|
17.1 |
Pimephales promelas 31 day |
Low |
|
> 100 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 60.7 |
Pseudokirchneriella subcapitata |
Low |
|
3.1 |
Green algae 4 days |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 639 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
1829 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.05 |
Rat SF=100 as 2,4-D |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
0.15 |
Rat SF=100 as 2,4-D |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B1 B = DNA damage/repair (EFSA database) 1 = Positive ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible liver, kidney & blood toxicant IARC listed carcinogen - 2B Possible negative impacts on endocrine system |
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to autoignite; Not highly flammable |
|
Health: H302, H317, H318, H335 Environment: H411 |
|
- |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
2,4-D-dimethylammonium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |